
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 121554-10-7 |
| Catalog No. | 2A-9076572 |
| Chinese Name | 5-溴-2-碘苯甲腈 |
| Synonyms | MFCD00672950; 5-Bromo-2-iodobenzonitrile |
| Molecular Formula | C7H3BrIN |
| Molecular Weight | 307.92 |
| Density | 2.3±0.1 g/cm3 |
| Boiling Point | 310.4±27.0 °C at 760 mmHg |
| Melting Point | 120-122°C |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2926909090 |
| PubChem ID | 17199393 |
| SMILES | N#Cc1cc(Br)ccc1I |
| InChI | InChI=1S/C7H3BrIN/c8-6-1-2-7(9)5(3-6)4-10/h1-3H |
| InChI Key | JIGKPMMZNMQXDL-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(1H-Imidazol-2-yl)-propionicacid | 178388-79-9 | 2A-9076554 |
| 1-(Pyridin-3-yl)cyclobutanamine | 1212058-02-0 | 2A-9076556 |
| 4-Chloropyridin-2-amine | 121307-80-0 | 2A-9076563 |
| 4-Chloro-1,2-benzisoxazol-3(2H)-one | 178748-22-6 | 2A-9076565 |
| 5-Isopropoxy-1H-pyrazol-3-ylamine | 121507-34-4 | 2A-9076571 |
| N,N'-(2,3-Dimethylbutane-2,3-diyl)bis(hydroxylamine)sulfate | 14538-51-3 | 2A-9076573 |
| 4-(2-Cbz-aminoEthyl)benzoicacid | 121632-81-3 | 2A-9076575 |
| 1-Bromo-2-chloro-3,4,5-trifluorobenzene | 122375-83-1 | 2A-9076580 |
| 1-(Benzo[d]oxazol-2-yl)ethanone | 122433-29-8 | 2A-9076584 |
| 5-Amino-4-fluoro-2-Methylphenol | 122455-85-0 | 2A-9076585 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA