
CAS Number143211-10-3
SynonymsMethyl 2-oxo-2-(2-((o-tolyloxy)methyl)phenyl)acetate; methyl 2-(2-methylphenoxymethyl)phenylglyoxylate; 2-oxo-2-(((o-tolyl)oxymethyl)phenyl)acetic acid methyl ester; methyl 2-oxo-2-[2-methylphenoxymethyl]phenylacetate
Molecular FormulaC17H16O4
Molecular Weight284.30700
Density1.175 g/cm3
Boiling Point425.436ºC at 760 mmHg
Melting Point53-55ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 143211-10-3 |
| Catalog No. | 2A-9076452 |
| Chinese Name | 2-(2-甲基苯氧甲基)苯基草酸甲酯 |
| Synonyms | Methyl 2-oxo-2-(2-((o-tolyloxy)methyl)phenyl)acetate; methyl 2-(2-methylphenoxymethyl)phenylglyoxylate; 2-oxo-2-(((o-tolyl)oxymethyl)phenyl)acetic acid methyl ester; methyl 2-oxo-2-[2-methylphenoxymethyl]phenylacetate |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.30700 |
| Density | 1.175 g/cm3 |
| Boiling Point | 425.436ºC at 760 mmHg |
| Melting Point | 53-55ºC |
| HTC | 2918990090 |
| PubChem ID | 16950808 |
| SMILES | COC(=O)C(=O)c1ccccc1COc1ccccc1C |
| InChI | InChI=1S/C17H16O4/c1-12-7-3-6-10-15(12)21-11-13-8-4-5-9-14(13)16(18)17(19)20-2/h3-10H,11H2,1-2H3 |
| InChI Key | DVQZMPYYTUUGAK-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Bromo-4-hydroxybenzoicacid | 14248-41-5 | 2A-9076433 |
| 2,3,4-Trifluorobenzenesulphonylchloride | 175278-08-7 | 2A-9076437 |
| Tert-butylcis-3-Hydroxymethylcyclobutylcarbamate | 142733-64-0 | 2A-9076439 |
| Beta-[[(1,1-Dimethylethoxy)carbonyl]amino]-benzenebutanoicacidmethylester | 142854-48-6 | 2A-9076441 |
| 4-Sulfamoylbutyricacid | 175476-52-5 | 2A-9076443 |
| 2,7-Dibromo-9,9-didecylfluorene | 175922-78-8 | 2A-9076458 |
| 1-(3-Amino-4-benzyloxy-phenyl)-ethanone | 14347-15-0 | 2A-9076463 |
| Abieticacidsodium | 14351-66-7 | 2A-9076464 |
| 3-Amino-2,6-difluorobenzonitrile | 143879-78-1 | 2A-9076470 |
| 6-Sulfonicotinicacid | 17624-03-2 | 2A-9076473 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA