
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17536-00-4 |
| Catalog No. | 2A-9076442 |
| Chinese Name | 3,5-二异丙基吡唑 |
| Synonyms | 3,5-di(propan-2-yl)-1H-pyrazole; 3,5-DIISOPROPYLPYRAZOLE |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 |
| Density | 0.862g/cm3 |
| Boiling Point | 595.8ºC at 760 mmHg |
| Melting Point | 88ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | Store under inert gas; avoid moisture (decompositi |
| HTC | 2933199090 |
| PubChem ID | 39266974 |
| MDL Number | MFCD00671516 |
| SMILES | CC(C)c1cc(C(C)C)[nH]n1 |
| InChI | InChI=1S/C9H16N2/c1-6(2)8-5-9(7(3)4)11-10-8/h5-7H,1-4H3,(H,10,11) |
| InChI Key | PJSJVTZSFIRYIZ-UHFFFAOYSA-N |
| MSDS | msds/76442_1_17536_00_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3,5-Diisopropylpyrazole Modification number: 2 |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-Chloro-2-methyl-5-(trifluoromethyl)pyridine | 175277-30-2 | 2A-9076426 |
| 4-(Dimethoxymethyl)-2-Methylpyrimidine | 175277-33-5 | 2A-9076428 |
| 4-(2-OxoEthyl)piperidine-1-carboxylicacidtert-butylester | 142374-19-4 | 2A-9076431 |
| 3,5-DiMethyl-4-nitropyridine-N-oxide | 14248-66-9 | 2A-9076435 |
| 5-Cyano-2-hydroxypyrimidine | 1753-49-7 | 2A-9076440 |
| 4-Methylbenzo[b]thiophene | 14315-11-8 | 2A-9076448 |
| 6-Bromo-2-chloro-4-methylquinazoline | 175724-46-6 | 2A-9076449 |
| 2-(Bromomethyl)-5-fluoro-1,3-benzothiazole | 143163-70-6 | 2A-9076450 |
| 4,5,6-Trifluoropyrimidine | 17573-78-3 | 2A-9076451 |
| 2-Chloro-N4-methyl-pyrimidine-4,5-diamine | 17587-95-0 | 2A-9076456 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA