
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 109613-93-6 |
| Catalog No. | 2A-9076303 |
| Chinese Name | 3,4-二甲氧基吡啶 |
| Synonyms | 3,4-Dimethoxypyridine; 3,4-dimethoxy-pyridine; 3,4-Dimethoxy-pyridin |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.152 |
| Purity | 96 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 202.6±20.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933399090 |
| PubChem ID | 6095654 |
| SMILES | COc1ccncc1OC |
| InChI | InChI=1S/C7H9NO2/c1-9-6-3-4-8-5-7(6)10-2/h3-5H,1-2H3 |
| InChI Key | OSSPPRKJEQZZQH-UHFFFAOYSA-N |
| MSDS | msds/76303_1_109613_93_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 6-Methyl-3H-thieno[2,3-d]pyrimidin-4-one | 108831-66-9 | 2A-9076279 |
| 2-Chloroquinazoline-4-carboxylicacidethylester | 1092352-52-7 | 2A-0200656 |
| Tert-butyl2-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate | 1092352-55-0 | 2A-9076286 |
| 4-(1-Methoxy-1-methylEthyl)-2-propyl-1H-Imidazole-5-carboxylicacidethylester | 1092980-84-1 | 2A-9076293 |
| 5-Ethynyl-3-methyl-1H-indazole | 1093307-29-9 | 2A-9076296 |
| 6-Aminopyridine-2-sulfonicacid | 109682-22-6 | 2A-9076304 |
| Octahydro-4H-pyrido[1,2-a]pyrazin-4-one | 109814-50-8 | 2A-9076307 |
| 2-Amino-3-pyridinethiol | 110402-20-5 | 2A-9076311 |
| Sodium5-methylthiazole-2-carboxylate | 1107062-31-6 | 2A-9076315 |
| 2-Amino-pyrido[3,2-d]pyrimidin-4(1H)-one | 110967-13-0 | 2A-9076318 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA