![7-Amino-1H-pyrrolo[3,2-b]pyridine structure, CAS 142078-41-9](/structures/80000/76212_2_142078_41_9.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 142078-41-9 |
| Catalog No. | 2A-9076212 |
| Chinese Name | 7-氨基-1H-吡咯[3,2-B]吡啶 |
| Synonyms | 1H-pyrrolo[3,2-b]pyridin-7-amine; CL3526; 7-amino-4-azaindole |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 152.58 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 399.6±22.0 °C at 760 mmHg |
| Appearance | White to yellow solid |
| Storage Condition | 2-8°C, protected from light |
| HTC | 2933990090 |
| PubChem ID | 37060714 |
| SMILES | Nc1ccnc2cc[nH]c12 |
| InChI | InChI=1S/C7H7N3/c8-5-1-3-9-6-2-4-10-7(5)6/h1-4,10H,(H2,8,9) |
| InChI Key | MNDKWHJWSWYUKL-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-Cyano-4-fluoropyridine | 1060802-53-0 | 2A-9076196 |
| 4-Fluoro-2-formylpyridine | 1060809-18-8 | 2A-9076198 |
| 4-Hydroxy-pyridine-2-carbaldehyde | 1060809-85-9 | 2A-9076199 |
| Ethyl1,2,3,4-tetrahydro-isoquinoline-1-carboxylate | 106181-28-6 | 2A-9076203 |
| 4-Piperazine-piperidine | 142013-66-9 | 2A-9076210 |
| 3-Bromo-5-(methylthio)pyridine | 142137-18-6 | 2A-9076214 |
| 3-(Iodomethyl)pyridine | 142179-84-8 | 2A-9076217 |
| Methyl2-phenyloxazole-5-carboxylate | 106833-83-4 | 2A-9076220 |
| 4-Bromo-7-methoxyquinoline | 1070879-27-4 | 2A-9076224 |
| 4-Bromo-7-fluoroquinoline | 1070879-29-6 | 2A-9076225 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA