
CAS Number14160-71-5
Synonyms2-hydroxy-5-ethoxybenzoic acid; 5-ethoxysalicylic acid; 5-Aethylaether-gentisinsaeure; 5-Aethoxy-salicylsaeure; MFCD00016503; EINECS 238-004-1; 5-ethoxy-2-hydroxy-benzoic acid; 5-Aethoxy-2-hydroxy-benzoesaeure
Molecular FormulaC9H10O4
Molecular Weight182.18
Density1.292g/cm3
Boiling Point354.1ºC at 760mmHg
Melting Point159-163ºC(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14160-71-5 |
| Catalog No. | 2A-9076178 |
| Chinese Name | 5-乙氧基-2-羟基苯甲酸 |
| Synonyms | 2-hydroxy-5-ethoxybenzoic acid; 5-ethoxysalicylic acid; 5-Aethylaether-gentisinsaeure; 5-Aethoxy-salicylsaeure; MFCD00016503; EINECS 238-004-1; 5-ethoxy-2-hydroxy-benzoic acid; 5-Aethoxy-2-hydroxy-benzoesaeure |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.18 |
| Density | 1.292g/cm3 |
| Boiling Point | 354.1ºC at 760mmHg |
| Melting Point | 159-163ºC(lit.) |
| Storage Condition | Store in a cool place. Keep container tightly clos |
| HTC | 2918990090 |
| MDL Number | MFCD00016503 |
| SMILES | CCOc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H10O4/c1-2-13-6-3-4-8(10)7(5-6)9(11)12/h3-5,10H,2H2,1H3,(H,11,12) |
| InChI Key | ZZKFPIOJAOEMQL-UHFFFAOYSA-N |
| MSDS | msds/76178_1_14160_71_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Ethynyl-2-methoxy-phenylamine | 105752-19-0 | 2A-9076173 |
| 2-Bromo-5-fluoro-benzenepropanoicacidethylester | 1057674-00-6 | 2A-9076174 |
| Benzeneaceticacid,3,4-dichloro-a-cyano- | 141516-10-1 | 2A-9076175 |
| 3,6-Dihydro-2H-pyran-4-carboxylicacidmethylester | 105772-14-3 | 2A-9076176 |
| Ethyl5-ethoxy-2-hydroxybenzoate | 14160-70-4 | 2A-9076177 |
| 2-(4-Methoxyphenoxy)aniline | 105901-39-1 | 2A-9076179 |
| N1-Benzyl-N1-methylethane-1,2-diamine | 14165-18-5 | 2A-9076180 |
| 3-Ethynyl-benzoicacid | 10601-99-7 | 2A-9076184 |
| Faropenemdaloxate | 141702-36-5 | 2A-9076185 |
| Hexahydropyrrolizin-1-one | 14174-83-5 | 2A-9076188 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA