
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14007-02-4 |
| Catalog No. | 2A-9076118 |
| Chinese Name | N-Butyl mandelate |
| Synonyms | Mandelsaeure-n-butylester; Butyl mandelate; n-BUTYL MANDELATE; mandelic acid-butyl ester |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.25400 |
| Density | 1.095g/cm3 |
| Boiling Point | 314.1ºC at 760mmHg |
| HTC | 2918199090 |
| PubChem ID | 476067 |
| SMILES | CCCCOC(=O)C(O)c1ccccc1 |
| InChI | InChI=1S/C12H16O3/c1-2-3-9-15-12(14)11(13)10-7-5-4-6-8-10/h4-8,11,13H,2-3,9H2,1H3 |
| InChI Key | QLVXFMSPNHAPMO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(3-Hydroxy-propylamino)-propan-1-ol | 14002-33-6 | 2A-9076112 |
| 2-Fluoro-5-hydroxybenzenecarbonitrile | 104798-53-0 | 2A-0201770 |
| 2-(Quinolin-4-yl)acetonitrile | 14003-46-4 | 2A-9076114 |
| D-Mannitol1-phosphatebariumsalt | 104835-69-0 | 2A-9076115 |
| 2-Butoxynaphthalene | 10484-56-7 | 2A-9076117 |
| Tert-butyl4-amino-2-fluorobenzoate | 140373-77-9 | 2A-9076125 |
| But-3-Yn-1-amine | 14044-63-4 | 2A-9076127 |
| 4-Sulfopicolinicacid | 14045-14-8 | 2A-9076130 |
| Ethyl4-methoxyphenylacetate | 14062-18-1 | 2A-9076132 |
| 2-Bromo-6-chloropyridin-3-amine | 1050501-88-6 | 2A-9076134 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA