![Ethyl3-[4-(benzyloxy)phenyl]acrylate structure, CAS 104315-07-3](/structures/80000/76082_1_104315_07_3.png)
CAS Number104315-07-3
Synonyms(E)-ethyl 3-(4-(benzyloxy)phenyl)acrylate; ethyl (E)-3-(4-benzyloxy-phenyl)-acrylate; (E)-ethyl 3-(benzo[d][1,3]dioxol-5-yl)acrylate; trans-ethyl-3-(1,3-benzodioxol-5-yl)prop-2-enoate; (E)-1,3-Benzodioxole-5-acrylic acid ethyl ester; ethyl (E)-3-(4-(benzyloxy)phenyl)-2-propanoate; (E)-ethyl 3-(benzo[d][1,3]dioxol-6-yl)acrylate; (E)-3-(4-benzyloxyphenyl)acrylicacid ethyl ester; (2E)-3-[4-(Phenylmethoxy)phenyl]-2-propenoic Acid Ethyl Ester; ethyl (E)-(4-benzyloxy)cinnamate; ethyl (2E)-3-[(3,4-methylenedioxy)phenyl]prop-2-enoate; 4-benzyloxycinnamic acid ethyl ester; ethyl 3-(3',4'-methylenedioxyphenyl)prop-2-enoate; ethyl 3-[(3',4'-methylenedioxy)phenyl]propenoate; (E)-3-(1,3-Benzodioxol-5-yl)propenoic acid ethyl ester; trans-1-carboxyethyl-2-(3',4'-methylenedioxyphenyl)ethene; ethyl (2E)-3-
Molecular FormulaC16H14O3
Molecular Weight254.288
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 104315-07-3 |
| Catalog No. | 2A-9076082 |
| Chinese Name | 乙基 3-[4-(苄氧基)苯基]丙烯酸酯 |
| Synonyms | (E)-ethyl 3-(4-(benzyloxy)phenyl)acrylate; ethyl (E)-3-(4-benzyloxy-phenyl)-acrylate; (E)-ethyl 3-(benzo[d][1,3]dioxol-5-yl)acrylate; trans-ethyl-3-(1,3-benzodioxol-5-yl)prop-2-enoate; (E)-1,3-Benzodioxole-5-acrylic acid ethyl ester; ethyl (E)-3-(4-(benzyloxy)phenyl)-2-propanoate; (E)-ethyl 3-(benzo[d][1,3]dioxol-6-yl)acrylate; (E)-3-(4-benzyloxyphenyl)acrylicacid ethyl ester; (2E)-3-[4-(Phenylmethoxy)phenyl]-2-propenoic Acid Ethyl Ester; ethyl (E)-(4-benzyloxy)cinnamate; ethyl (2E)-3-[(3,4-methylenedioxy)phenyl]prop-2-enoate; 4-benzyloxycinnamic acid ethyl ester; ethyl 3-(3',4'-methylenedioxyphenyl)prop-2-enoate; ethyl 3-[(3',4'-methylenedioxy)phenyl]propenoate; (E)-3-(1,3-Benzodioxol-5-yl)propenoic acid ethyl ester; trans-1-carboxyethyl-2-(3',4'-methylenedioxyphenyl)ethene; ethyl (2E)-3- |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.288 |
| HTC | 2918990090 |
| PubChem ID | 3215081 |
| MDL Number | MFCD00021778 |
| SMILES | CCOC(=O)C=Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H18O3/c1-2-20-18(19)13-10-15-8-11-17(12-9-15)21-14-16-6-4-3-5-7-16/h3-13H,2,14H2,1H3/b13-10+ |
| InChI Key | IWYBNMQBSPKPRB-JLHYYAGUSA-N |
| MSDS | msds/76082_1_104315_07_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(4-Chloro-3-pyridinyl)acetamide | 138769-30-9 | 2A-9076070 |
| 1-(4-Chloro-2-methyl-3-quinolinyl)-ethanone | 138770-67-9 | 2A-9076071 |
| 2-Chloro-4-hydroxy-benzoicacidmethylester | 104253-44-3 | 2A-9076078 |
| 3,5-Dinitropyridin-4-ol | 10425-71-5 | 2A-9076080 |
| 2-Benzoxazolone-5-methylsulfone | 13920-98-4 | 2A-9076081 |
| 2,6-Dichlorobenzotrifluoride | 104359-35-5 | 2A-9076086 |
| Tetrabutylammoniumcyanide | 10442-39-4 | 2A-9076092 |
| 5-Bromo-4-chloropyrimidin-2-amine | 1044767-99-8 | 2A-9076094 |
| Thiostreptonfromstreptomycesazureus | 1393-48-2 | 2A-9076095 |
| 5-Bromo-2-Methylpyridin-4-amine | 10460-50-1 | 2A-9076100 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS