
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13721-00-1 |
| Catalog No. | 2A-9076032 |
| Chinese Name | 2,3-二溴喹啉 |
| Synonyms | 2,3,5-TRI-O-BENZOYL-1-O-ACETYL-B-D-RIBOFURANOSE; 2,3-Dibrom-chinolin; 2,3-dibromoquinoline; 2,3-dibromo-quinoline; 2,3-Dibromochinolin |
| Molecular Formula | C9H5Br2N |
| Molecular Weight | 286.95 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 332.5±22.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2933499090 |
| PubChem ID | 3190450 |
| SMILES | Brc1cc2ccccc2nc1Br |
| InChI | InChI=1S/C9H5Br2N/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h1-5H |
| InChI Key | KWVPZTJLHQKCKD-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-(4-Chlorophenyl)pyrrolidine | 120418-62-4 | 2A-9076023 |
| 5-Methoxy-2-phenyl-2H-indazole | 120455-03-0 | 2A-9076027 |
| (4-Bromopyridine-2,6-diyl)dimethanol | 120491-88-5 | 2A-9076028 |
| 2-Phenyl-5-thiazolecarboxylicacidmethylester | 172678-68-1 | 2A-9076030 |
| Methyl-2(4-Chloropyridine-2yl)acetate | 1206247-78-0 | 2A-9076031 |
| 3-Cyclohexylthiophene | 120659-34-9 | 2A-9076034 |
| 4-Chloro-7-fluoro-2-methylquinazoline | 1206694-32-7 | 2A-9076039 |
| 6-Bromo-5-methoxy-1H-indazole | 1206800-17-0 | 2A-9076041 |
| 3-Methyl-pyrrolidinehydrochloride | 120986-92-7 | 2A-9076048 |
| 1-Benzyl-3-oxopiperazine | 13754-41-1 | 2A-9076053 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA