CAS Number5292-47-7
SynonymsMFCD00042266; 1,4-Benzenedicarboxylic acid, 2-fluoro-, dimethyl ester; dimethyl 2-fluorobenzene-1,4-dicarboxylate; EINECS 226-135-7; Dimethyl 2-fluoroterephthalate
Molecular FormulaC10H9FO4
Molecular Weight212.174
Purity98%
Density1.3±0.1 g/cm3
Boiling Point299.4±30.0 °C at 760 mmHg
Melting Point83-85 °C(lit.)
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5292-47-7 |
| Catalog No. | 2A-9007601 |
| Chinese Name | 2-氟对苯二甲酸二甲酯 |
| Synonyms | MFCD00042266; 1,4-Benzenedicarboxylic acid, 2-fluoro-, dimethyl ester; dimethyl 2-fluorobenzene-1,4-dicarboxylate; EINECS 226-135-7; Dimethyl 2-fluoroterephthalate |
| Molecular Formula | C10H9FO4 |
| Molecular Weight | 212.174 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 299.4±30.0 °C at 760 mmHg |
| Melting Point | 83-85 °C(lit.) |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Store at room temperature, away from light, in a c |
| HTC | 2917399090 |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(F)c1 |
| InChI | InChI=1S/C10H9FO4/c1-14-9(12)6-3-4-7(8(11)5-6)10(13)15-2/h3-5H,1-2H3 |
| InChI Key | NCRFSIQSCLJDIC-UHFFFAOYSA-N |
| MSDS | msds/7601_1_5292_47_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dihydroproscar | 98319-24-5 | 2A-9007593 |
| Dihydroprunetin | 2A-107594 | 2A-9007594 |
| Diketene; Acetyl ketene | 674-82-8 | 2A-9007598 |
| Dimercaprol | 59-52-9 | 2A-9007599 |
| Dimetachlone | 24096-53-5 | 2A-9007600 |
| Dimethyl 2-oxoglutarate | 13192-04-6 | 2A-0201508 |
| Dimethyl cyanocarbonimidate | 24771-25-3 | 2A-9007605 |
| Dimethyl fluoromalonate | 344-14-9 | 2A-9007606 |
| Dimethyl iminodiacetate hydrochloride | 39987-25-2 | 2A-9007607 |
| Dimethyl Isophthalate-5-sulfonate | 138-25-0 | 2A-9007608 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS