
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 117009-97-9 |
| Catalog No. | 2A-9075848 |
| Chinese Name | 1-高哌嗪羧酸苄酯 |
| Synonyms | benzyl 1,4-diazepane-1-carboxylate; MFCD01863703; 1-(Benzyloxycarbonyl)homopiperazine |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.29400 |
| Density | 1.13 g/mL at 25ºC(lit.) |
| Boiling Point | 130ºC0.5 mm Hg(lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933990090 |
| PubChem ID | 6460312 |
| SMILES | O=C(OCc1ccccc1)N1CCCNCC1 |
| InChI | InChI=1S/C13H18N2O2/c16-13(15-9-4-7-14-8-10-15)17-11-12-5-2-1-3-6-12/h1-3,5-6,14H,4,7-11H2 |
| InChI Key | BXDQJVDEALOIQW-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Benzyl-2-morpholinecarboxylicacidHCL | 135072-15-0 | 2A-9075831 |
| Ethyl4-benzylmorpholine-2-carboxylate | 135072-32-1 | 2A-9075832 |
| 4-Methyl-1H-imidazole-2-carboxaldehyde | 116825-16-4 | 2A-9075834 |
| 4-Chloro-5-fluoro-2-Methylpyridine | 169750-95-2 | 2A-9075837 |
| 4-(1H-Pyrrol-1-yl)piperidine | 169751-01-3 | 2A-9075839 |
| Tert-butyl4-(2-aminophenyl)piperazine-1-carboxylate | 170017-74-0 | 2A-9075852 |
| 5-(Dimethoxymethyl)-1-Ethyl-1H-pyrazole | 1170194-07-6 | 2A-9075853 |
| 6,7-Dihydro-5H-pyrrolo[2,1-c]-1,2,4-triazole-3-methanaminehydrochloride | 1171236-13-7 | 2A-9075855 |
| 2-Phenyl-4,5,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridinehydrochloride | 1171476-07-5 | 2A-9075857 |
| 3-(Chloromethyl)-1-methyl-1H-1,2,4-triazole | 135206-76-7 | 2A-9075860 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA