
CAS Number6628-68-8
SynonymsDiethyl 2-phenylethylmalonate; Diethyl ester of 2-Phenethylmalonic acid; EINECS 229-610-7; MFCD00026887; diethyl phenethylmalonate; 2-phenethylmalonic acid diethyl ester
Molecular FormulaC15H20O4
Molecular Weight264.324
Purity98%
Density1.078 g/cm3
Boiling Point356.4ºC at 760 mmHg ,112-114ºC 0,2mm
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6628-68-8 |
| Catalog No. | 2A-9007561 |
| Chinese Name | 2-苯乙基丙二酸二乙酯 |
| Synonyms | Diethyl 2-phenylethylmalonate; Diethyl ester of 2-Phenethylmalonic acid; EINECS 229-610-7; MFCD00026887; diethyl phenethylmalonate; 2-phenethylmalonic acid diethyl ester |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.324 |
| Purity | 98 |
| Density | 1.078 g/cm3 |
| Boiling Point | 356.4ºC at 760 mmHg ,112-114ºC 0,2mm |
| Storage Condition | Room Temperature |
| HTC | 2917190090 |
| MDL Number | MFCD00026887 |
| SMILES | CCOC(=O)C(CCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C15H20O4/c1-3-18-14(16)13(15(17)19-4-2)11-10-12-8-6-5-7-9-12/h5-9,13H,3-4,10-11H2,1-2H3 |
| InChI Key | LMFLGETWXFOVMQ-UHFFFAOYSA-N |
| MSDS | msds/7561_1_6628_68_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dibutylsuccinate | 141-03-7 | 2A-9007553 |
| Dichloromide | 37764-25-3 | 2A-9007555 |
| Dicyclopentadiene | 77-73-6 | 2A-9007557 |
| Dicyclopropylketone | 1121-37-5 | 2A-9007558 |
| Diethyl 2-(2-cyanoethyl)malonate | 17216-62-5 | 2A-9007560 |
| Diethyl 2-(trifluoromethoxy)phenylamino-N-methylene malonate | 49713-41-9 | 2A-9007562 |
| Diethyl 5-nitroisophthalate | 10560-13-1 | 2A-9007566 |
| Diethyl aminomalonate | 6829-40-9 | 2A-9007567 |
| Diethyl fluoromalonate | 685-88-1 | 2A-9007568 |
| Diethyl ketomalonate | 609-09-6 | 2A-9007569 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA