
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 102503-23-1 |
| Catalog No. | 2A-9075510 |
| Chinese Name | 2,4-二甲氧基-N-甲基苯甲胺 |
| Synonyms | 1-(2,4-Dimethoxyphenyl)-N-methylmethanamine; N-(2,4-Dimethoxybenzyl)-N-methylamine |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 262.1±25.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2922299090 |
| PubChem ID | 5603631 |
| SMILES | CNCc1ccc(OC)cc1OC |
| InChI | InChI=1S/C10H15NO2/c1-11-7-8-4-5-9(12-2)6-10(8)13-3/h4-6,11H,7H2,1-3H3/p+1 |
| InChI Key | ULVUWTHGZHDWMW-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridinehydrochloride | 1187830-87-0 | 2A-9075098 |
| 5-(2,4-Dichloro-5-Fluorophenyl)-1H-Pyrazole-3-Carboxylicacid | 1119299-75-0 | 2A-9075345 |
| 5-(2,4-Dichlorophenyl)-1H-Pyrazole-3-Carboxylicacid | 78874-27-8 | 2A-9075348 |
| 5-(4-Chlorophenyl)-1-(2,4-Dichlorophenyl)-4-Methylpyrazole-3-Carboxylicacid | 162758-35-2 | 2A-9075367 |
| Ethyl3-(2,4-Difluoroanilino)-2-(2,6-dichloro-5-fluronicotinoyl)acrylate | 100490-99-1 | 2A-9075420 |
| 5-Chloro-2,4-Difluoroaniline | 870606-45-4 | 2A-9075592 |
| 5-Isobutyl-Imidazolidine-2,4-Dione | 58942-03-3 | 2A-9075606 |
| 7-Bromo-2,4-Diaminoquinazoline | 137553-43-6 | 2A-9075729 |
| 1-Methyl-3,5-bis-O-(2,4-dichlorobenzyl)-alpha-D-ribofuranoside | 168427-35-8 | 2A-9075770 |
| 2,4,5-Trifluorobenzylamine | 168644-93-7 | 2A-9075781 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA