
CAS Number2003-10-3
Synonyms2-Bromo-1-[3-(trifluoromethyl)phenyl]-1-ethanone; 3'-(Trifluoromethyl)phenacyl bromide; 3-trifluoromethylphenacyl bromide; 2-bromo-1-[3-(trifluoromethyl)phenyl]ethan-1-one; MFCD03094283; 2-Bromo-1-[3-(trifluoromethyl)phenyl]ethanone; FXFFR CV1E; m-(Trifluoromethyl)phenacyl Bromide; 2-bromo-1-(3-(trifluoromethyl)phenyl)ethanone
Molecular FormulaC9H6BrF3O
Molecular Weight267.05
Density1.6±0.1 g/cm3
Boiling Point232.4±35.0 °C at 760 mmHg
Melting Point22ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2003-10-3 |
| Catalog No. | 2A-9075358 |
| Chinese Name | 2-溴-3-(三氟甲基)苯乙酮 |
| Synonyms | 2-Bromo-1-[3-(trifluoromethyl)phenyl]-1-ethanone; 3'-(Trifluoromethyl)phenacyl bromide; 3-trifluoromethylphenacyl bromide; 2-bromo-1-[3-(trifluoromethyl)phenyl]ethan-1-one; MFCD03094283; 2-Bromo-1-[3-(trifluoromethyl)phenyl]ethanone; FXFFR CV1E; m-(Trifluoromethyl)phenacyl Bromide; 2-bromo-1-(3-(trifluoromethyl)phenyl)ethanone |
| Molecular Formula | C9H6BrF3O |
| Molecular Weight | 267.05 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 232.4±35.0 °C at 760 mmHg |
| Melting Point | 22ºC |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| PubChem ID | 3215324 |
| SMILES | O=C(CBr)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6BrF3O/c10-5-8(14)6-2-1-3-7(4-6)9(11,12)13/h1-4H,5H2 |
| InChI Key | TZIYNLSEBAYCBZ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Pyrimidin-5-Yl-Benzaldehyde | 198084-12-7 | 2A-9075334 |
| 4-Thiazol-2-Yl-Benzaldehyde | 198904-53-9 | 2A-9075337 |
| Methyl2-amino-4-(trifluoromethyl)benzoate | 61500-87-6 | 2A-9075338 |
| 2-Bromo-4-(trifluoromethyl)benzaldehyde | 85118-24-7 | 2A-9075346 |
| 3-Chloro-4-(trifluoromethoxy)benzaldehyde | 83279-38-3 | 2A-9075353 |
| 5-Bromo-2-Methylbenzaldehyde | 90050-59-2 | 2A-9075419 |
| 5-Bromo-2-Nitrobenzaldehyde | 20357-20-4 | 2A-9075423 |
| 7-(Trifluoromethyl)-1H-benzimidazol-2-amine | 10057-45-1 | 2A-9075429 |
| 6-(Trifluoromethyl)-1H-benzimidazol-2-amine | 10057-46-2 | 2A-9075430 |
| 1-Chloro-3-fluoro-5-(trifluoromethyl)benzene | 1005764-23-7 | 2A-9075433 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA