
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 699016-40-5 |
| Catalog No. | 2A-9075178 |
| Chinese Name | 2-氟-4-碘苯甲醛 |
| Synonyms | Benzaldehyde,2-fluoro-4-iodo; 3-Fluoro-4-formyliodobenzene; 2-fluoro-4-iodo-benzaldehyde; VHR DI BF; 2-Fluoro-4-iodobenzaldehyde; BH785 |
| Molecular Formula | C7H4FIO |
| Molecular Weight | 250.01 |
| Density | 2.0±0.1 g/cm3 |
| Boiling Point | 259.9±25.0 °C at 760 mmHg |
| Storage Condition | -20°C, protected from light and stored in inert ga |
| HTC | 2913000090 |
| PubChem ID | 6008867 |
| SMILES | O=Cc1ccc(I)cc1F |
| InChI | InChI=1S/C7H4FIO/c8-7-3-6(9)2-1-5(7)4-10/h1-4H |
| InChI Key | LMDKAOXRCQPCAW-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(6-Chloropyridazin-3-Yl)Benzaldehyde | 914349-19-2 | 2A-9074958 |
| 4-(Bromomethyl)Benzylaminehydrobromide | 34403-47-9 | 2A-9074962 |
| 4-{4-[Bis(4-Fluorophenyl)Methyl]Piperazin-1-Yl}Benzaldehyde | 914349-58-9 | 2A-9075011 |
| 4-Bromo-2-Methoxybenzaldehyde | 43192-33-2 | 2A-9075087 |
| 2-Chloro-6-methoxybenzaldehyde | 29866-54-4 | 2A-9075156 |
| 2-Hydroxy-3,6-dimethylbenzaldehyde | 1666-04-2 | 2A-9075181 |
| 2-Methyl-6-(trifluoromethyl)pyrimidin-4-ol | 2836-44-4 | 2A-9075206 |
| 2-Phenyl-5-trifluoromethyl-2H-pyrazol-3-ol | 96145-98-1 | 2A-9075235 |
| 4-Difluoromethoxy-3-Hydroxybenzaldehyde | 151103-08-1 | 2A-9075251 |
| 2-Piperazin-1-yl-benzaldehyde | 736991-52-9 | 2A-9075264 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA