
CAS Number17345-77-6
Synonyms4-BROMOCATECHOL; 4-Bromobenzene-1,2-diol; EINECS 241-370-5; 4-Bromo-1,2-benzenediol; 4-Bromo-1,2-dihydroxybenzene
Molecular FormulaC6H5BrO2
Molecular Weight189.01
Density1.8±0.1 g/cm3
Boiling Point280.5±20.0 °C at 760 mmHg
Melting Point87ºC
Appearancebrown powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17345-77-6 |
| Catalog No. | 2A-9075125 |
| Chinese Name | 4-溴邻苯二酚 |
| Synonyms | 4-BROMOCATECHOL; 4-Bromobenzene-1,2-diol; EINECS 241-370-5; 4-Bromo-1,2-benzenediol; 4-Bromo-1,2-dihydroxybenzene |
| Molecular Formula | C6H5BrO2 |
| Molecular Weight | 189.01 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 280.5±20.0 °C at 760 mmHg |
| Melting Point | 87ºC |
| Appearance | brown powder |
| Storage Condition | Room temperature, inert gas atmosphere |
| HTC | 2908199090 |
| PubChem ID | 8170413 |
| SMILES | Oc1ccc(Br)cc1O |
| InChI | InChI=1S/C6H5BrO2/c7-4-1-2-5(8)6(9)3-4/h1-3,8-9H |
| InChI Key | AQVKHRQMAUJBBP-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ethyl2-(3-hydroxy-2-oxopyrazin-1(2H)-yl)acetate | 1194374-12-3 | 2A-9075101 |
| 4-Bromo-3-Nitrobenzene-1,2-Diamine | 147021-89-4 | 2A-9075108 |
| 2-Bromo-6-chlorobenzonitrile | 6575-08-2 | 2A-9075113 |
| 2-Bromo-6-fluoronitrobenzene | 886762-70-5 | 2A-9075115 |
| 2-Bromoethyldimethylamine | 5459-68-7 | 2A-9075121 |
| 1-(thiazol-2-yl)ethanaminehydrochloride | 432047-36-4 | 2A-9075130 |
| 2-Chloro-3-methoxyphenol | 72232-49-6 | 2A-9075133 |
| 4-(3-bromophenyl)pyrrolidin-2-one | 1105187-44-7 | 2A-9075147 |
| 4-(3-aminophenyl)pyrrolidin-2-onehydrochloride | 1187830-88-1 | 2A-9075150 |
| 6,7-dihydro-1-methyl-1H-indol-4(5H)-one | 51471-08-0 | 2A-9075155 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA