CAS Number162046-66-4
Synonyms4-[4-(tert-Butoxycarbonyl)piperazin-1-yl]benzoic acid; 1-Piperazinecarboxylic acid, 4-(4-carboxyphenyl)-, 1-(1,1-dimethylethyl) ester; 4-(4-Carboxyphenyl)piperazine-1-carboxylic acid tert-butyl ester; 4-(4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1-piperazinyl)benzoic acid; MFCD04115067; 4-(4-Carboxy-phenyl)-piperazine-1-c; arboxylic acid tert-butyl ester; 4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid
Molecular FormulaC16H22N2O4
Molecular Weight306.36
Density1.2±0.1 g/cm3
Boiling Point476.9±40.0 °C at 760 mmHg
Melting Point50ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 162046-66-4 |
| Catalog No. | 2A-9074859 |
| Chinese Name | 4-(4-羧基苯基)哌嗪-1-羧酸叔丁酯 |
| Synonyms | 4-[4-(tert-Butoxycarbonyl)piperazin-1-yl]benzoic acid; 1-Piperazinecarboxylic acid, 4-(4-carboxyphenyl)-, 1-(1,1-dimethylethyl) ester; 4-(4-Carboxyphenyl)piperazine-1-carboxylic acid tert-butyl ester; 4-(4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1-piperazinyl)benzoic acid; MFCD04115067; 4-(4-Carboxy-phenyl)-piperazine-1-c; arboxylic acid tert-butyl ester; 4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 476.9±40.0 °C at 760 mmHg |
| Melting Point | 50ºC |
| Storage Condition | Room temperature, dry and sealed |
| Application | Boc piperazine benzoic acid is a PROTAC linker that can be used to synthesize PROTAC, such as the PROTAC androgen receptor (AR) degrader ARD-2128 (HY-13229) [1]. |
| HTC | 2933599090 |
| PubChem ID | 329783292 |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C16H22N2O4/c1-16(2,3)22-15(21)18-10-8-17(9-11-18)13-6-4-12(5-7-13)14(19)20/h4-7H,8-11H2,1-3H3,(H,19,20)/p-1 |
| InChI Key | BEDWYXZFIYMEJG-UHFFFAOYSA-N |
| Bioactivity | Chemical & Physical Properties |
| Use of | Boc-piperazine-benzoic acid is a PROTAC linker and can be used in the synthesis of PROTACs, such as PROTAC androgen receptor (AR) degrader ARD-2128 (HY-13229)[1]. Properties Biological Activity Chemical & Physical Properties |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-(Phenylmethoxy)-4-pyrimidinamine | 60722-67-0 | 2A-9074852 |
| 4-(3-Bromoimidazo[1,2-B]Pyridazin-6-Yl)Morpholine | 1012343-72-4 | 2A-9074853 |
| 4-(4-Aminophenyl)Piperazine-1-Carboxylicacidtert-butylester | 170911-92-9 | 2A-9074854 |
| 2,2-Dimethyl-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one | 20348-21-4 | 2A-9074855 |
| 4-(4-Bromopyrimidin-2-Yl)Morpholine | 663194-10-3 | 2A-9074858 |
| 4-(4-Chlorothiazol-2-Yl)Morpholine | 848841-68-9 | 2A-9074860 |
| 4-(4-Cyanobenzyl)Piperidinehydrochloride | 333987-04-5 | 2A-9074861 |
| 7-bromo-4-chloropyrido[3,2-d]pyrimidine | 573675-31-7 | 2A-9074865 |
| 4-chloro-6,7-difluoroquinazoline | 625080-60-6 | 2A-9074875 |
| 6-chloroquinazoline | 700-78-7 | 2A-9074877 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS