
CAS Number181289-33-8
Synonyms(3R)-3-(2-Amino-2-oxoethyl)-5-methylhexanoic acid; ZV1Y1VQ1Y1&1 &&R Form; (R)-(-)-3-(carbamoylmethyl)-5-methylhexanoic acid; 3-CarbaMoyl Mehyl-5-Methyl Hexanoic Acid; (r)-(-)-3-(2-amino-2-oxoethyl)-5-methylhexanoic acid; (3R)-3-(carbamoylmethyl)-5-methylhexanoic acid; (r)-(-)-3-carbamoymethyl-5-methylhexanoic acid; INTERMEDIATE OF PREGABALIN
Molecular FormulaC9H17NO3
Molecular Weight187.24
Density1.1±0.1 g/cm3
Boiling Point401.9±28.0 °C at 760 mmHg
Melting Point128-133ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 181289-33-8 |
| Catalog No. | 2A-1074699 |
| Chinese Name | (R)-(-)-3-(氨甲酰甲基)-5-甲基己酸 |
| Synonyms | (3R)-3-(2-Amino-2-oxoethyl)-5-methylhexanoic acid; ZV1Y1VQ1Y1&1 &&R Form; (R)-(-)-3-(carbamoylmethyl)-5-methylhexanoic acid; 3-CarbaMoyl Mehyl-5-Methyl Hexanoic Acid; (r)-(-)-3-(2-amino-2-oxoethyl)-5-methylhexanoic acid; (3R)-3-(carbamoylmethyl)-5-methylhexanoic acid; (r)-(-)-3-carbamoymethyl-5-methylhexanoic acid; INTERMEDIATE OF PREGABALIN |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 401.9±28.0 °C at 760 mmHg |
| Melting Point | 128-133ºC |
| Storage Condition | room temperature, dry |
| HTC | 2924199090 |
| PubChem ID | 16154857 |
| MDL Number | MFCD09028111 |
| SMILES | NC(=O)C[C@@H](CC(C)C)CC(=O)O |
| InChI | InChI=1S/C9H17NO3/c1-6(2)3-7(4-8(10)11)5-9(12)13/h6-7H,3-5H2,1-2H3,(H2,10,11)(H,12,13)/t7-/m1/s1 |
| InChI Key | NPDKTSLVWGFPQG-SSDOTTSWSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 12352200 |
| MSDS | msds/74699_1_181289_33_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| tert-butyl5-chlorospiro[indoline-3,4'-piperidine]-1'-carboxylate | 637362-21-1 | 2A-9074672 |
| benzyl5-chlorospiro[indoline-3,4'-piperidine]-1'-carboxylate | 1041704-16-8 | 2A-9074674 |
| (2s,4s)-1-t-butoxycarbonyl-2-(N-T-butoxycarbonyl-N-sulfamoylamino)methyl-4-mercapto-pyrrolidine | 148017-44-1 | 2A-9074692 |
| (2S,3S,5S)-5-(acetoxymethyl)-tetrahydrofuran-2,3-diyldiacetate | 865853-43-6 | 2A-9074696 |
| (R)-pyrrolidin-2-ylmethanamine | 72300-69-7 | 2A-9074697 |
| ethyl3-bromoH-imidazo[1,2-a]pyridine-5-carboxylate | 429690-42-6 | 2A-0201231 |
| H-imidazo[1,5-a]pyridine-7-carboxylicacid | 588720-29-0 | 2A-9074722 |
| (S)-7-Amino-5-azaspiro[2.4]heptanedihydrochloride | 173904-24-0 | 2A-9074751 |
| (S)-5-Azaspiro[2.4]heptan-7-amine | 129306-12-3 | 2A-9074752 |
| 3-(trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine | 624734-27-6 | 2A-9074753 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA