
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 95636-02-5 |
| Catalog No. | 2A-9074691 |
| Chinese Name | 反-8-甲基-6-壬酰氯 |
| Synonyms | MFCD06797318; trans-8-methyl-6-nonenoyl chloride |
| Molecular Formula | C10H17O1Cl1 |
| Molecular Weight | 188.7 |
| Density | 0.962 g/cm3 |
| Boiling Point | 237.6ºC at 760 mmHg |
| Appearance | Colorless to yellow liquid |
| Storage Condition | Store airtight in a cool, dry warehouse. |
| Packaging | II |
| HTC | 2916190090 |
| PubChem ID | 11968918 |
| MDL Number | MFCD06797318 |
| SMILES | CC(C)C=CCCCCC(=O)Cl |
| InChI | InChI=1S/C10H17ClO/c1-9(2)7-5-3-4-6-8-10(11)12/h5,7,9H,3-4,6,8H2,1-2H3/b7-5+ |
| InChI Key | JDZRIGWDAPNYLT-FNORWQNLSA-N |
| Hazard Symbols | Category 8 |
| MSDS | msds/74691_1_95636_02_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3265 Proper shipping name: Corrosive Liquid, Acidic, Organic, Not Otherwise Specified Packing grade: II |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (2-Oxo-pentyl)-carbamicacidtert-butylester | 400045-87-6 | 2A-9074685 |
| (2-Hydroxy-propyl)-carbamicacidtert-butylester | 95656-86-3 | 2A-9074687 |
| N-(4-Amino-butyl)-acetamide | 18233-70-0 | 2A-9074688 |
| 3,5-Dioxo-hexanoicacidmethylester | 29736-80-9 | 2A-9074689 |
| 2-Bromo-N-isopropyl-acetamide | 75726-96-4 | 2A-9074690 |
| D-Threo-3-phenylserine | 109120-55-0 | 2A-9074693 |
| 2-Fluoro-3-iodo-5-picoline | 153034-78-7 | 2A-9074695 |
| 3-Methylamino-1-phenylpropanol | 421242-52-9 | 2A-9074698 |
| 4-(2-hydroxyethyl)indolin-2-one | 139122-19-3 | 2A-9074700 |
| PYRIDIN-3-YLMETHYL-HYDRAZINE | 7112-38-1 | 2A-9074701 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA