![5,6-DIHYDROBENZO[D]THIAZOL-7(4H)-ONE structure, CAS 935850-03-6](/structures/80000/74575_2_935850_03_6.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 935850-03-6 |
| Catalog No. | 2A-9074575 |
| Chinese Name | 5,6-二氢苯并[D]噻唑-7(4H)-酮 |
| Synonyms | 5,6-Dihydro-1,3-benzothiazol-7(4H)-one |
| Molecular Formula | C7H7NOS |
| Molecular Weight | 153.2 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 298.3±9.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2934200090 |
| PubChem ID | 29464021 |
| SMILES | O=C1CCCc2ncsc21 |
| InChI | InChI=1S/C7H7NOS/c9-6-3-1-2-5-7(6)10-4-8-5/h4H,1-3H2 |
| InChI Key | RENBIQXXBKOXQC-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-PHENOXYNICOTINICACID | 51362-38-0 | 2A-9074567 |
| 6-(2,5-DIMETHYLPHENOXY)NICOTINICACID | 954264-14-3 | 2A-9074571 |
| 1-Isopropyl-piperidin-3-one | 7799-73-6 | 2A-9074572 |
| PYRROL-1-YL-CARBAMICACIDTERT-BUTYLESTER | 937046-95-2 | 2A-9074573 |
| 1-Isoquinolin-1-ylmethanamine | 40615-08-5 | 2A-9074574 |
| 1-Phenylcycloheptylaminehydrochloride | 125802-37-1 | 2A-9074585 |
| 3-AMINOBENZO[E][1,2,4]TRIAZIN-7-OL | 877874-01-6 | 2A-9074587 |
| 1-Piperidin-4-yl-pyrrolidin-2-one | 91596-61-1 | 2A-9074588 |
| 1-Pyrimidin-2-yl-piperidin-4-ol | 893755-98-1 | 2A-9074592 |
| 1-Pyrimidin-2-yl-piperidin-4-one | 116247-92-8 | 2A-9074593 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA