
CAS Number1460-16-8
SynonymsCycloheptane carboxylic acid; Cycloheptanecarboxylic acid; MFCD00004152; Cycloheptancarbonsaeure; Cyclohexylamine; EINECS 215-954-5; cycloheptylcarboxylic acid; Cycloheptanoic acid; Cycloheptanecarboxylicacid; Cyclohepatan carboxylic acid
Molecular FormulaC13H23O4N1
Molecular Weight257.33
Purity99%
Density1.0±0.1 g/cm3
Boiling Point262.6±0.0 °C at 760 mmHg
Melting Point71ºC
AppearanceTransparent colorless liquid
EINECS215-954-5
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1460-16-8 |
| Catalog No. | 2A-9007453 |
| Chinese Name | 环庚烷羧酸 |
| Synonyms | Cycloheptane carboxylic acid; Cycloheptanecarboxylic acid; MFCD00004152; Cycloheptancarbonsaeure; Cyclohexylamine; EINECS 215-954-5; cycloheptylcarboxylic acid; Cycloheptanoic acid; Cycloheptanecarboxylicacid; Cyclohepatan carboxylic acid |
| Molecular Formula | C13H23O4N1 |
| Molecular Weight | 257.33 |
| Purity | 99 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 262.6±0.0 °C at 760 mmHg |
| Melting Point | 71ºC |
| Appearance | Transparent colorless liquid |
| Storage Condition | Room temperature, avoid light, ventilated and dry |
| EINECS | 215-954-5 |
| HTC | 2916209090 |
| MDL Number | MFCD03426130 |
| SMILES | O=C(O)C1CCCCCC1 |
| InChI | InChI=1S/C8H14O2/c9-8(10)7-5-3-1-2-4-6-7/h7H,1-6H2,(H,9,10) |
| InChI Key | VZFUCHSFHOYXIS-UHFFFAOYSA-N |
| MSDS | msds/7453_1_1460_16_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Chromone-2-carboxylic acid | 4940-39-0 | 2A-9007406 |
| Chromone-3-carboxylic acid | 39079-62-4 | 2A-9007407 |
| cis-1,4-Cyclohexanedicarboxylic acid | 619-81-8 | 2A-9007418 |
| Cyclobutane-1,1-dicarboxylic acid diethyl ester | 3779-29-1 | 2A-9007449 |
| Cyclobutanecarboxylic acid | 3721-95-7 | 2A-9007451 |
| cyclohex-3-enecarbaldehyde | 100-50-5 | 2A-9007456 |
| Cyclohexanecarboxaldehyde | 2043-61-0 | 2A-9007457 |
| Cyclopentylboronic acid | 63076-51-7 | 2A-9007465 |
| Cyclopropane-1,2-dicarbohydrazide | 89365-16-2 | 2A-9007468 |
| D-(+)-Glyceraldehyde | 453-17-8 | 2A-9007499 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA