
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 142137-17-5 |
| Catalog No. | 2A-9074474 |
| Chinese Name | 3-溴-5-苯基吡啶 |
| Synonyms | 5-phenyl-3-bromopyridine; 3-bromo-5-phenyl-pyridine |
| Molecular Formula | C11H8BrN |
| Molecular Weight | 234.1 |
| Density | 1.426 g/cm3 |
| Boiling Point | 308.4ºC at 760 mmHg |
| Melting Point | 46.0 to 50.0 °C |
| Storage Condition | room temperature, dry |
| HTC | 2933399090 |
| PubChem ID | 3191173 |
| SMILES | Brc1cncc(-c2ccccc2)c1 |
| InChI | InChI=1S/C11H8BrN/c12-11-6-10(7-13-8-11)9-4-2-1-3-5-9/h1-8H |
| InChI Key | AWCQJXPOCRXHNK-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-(PYRIDIN-4-YLMETHYL)PYRIDINE | 78903-70-5 | 2A-9074445 |
| 1-Boc-3-iodo-1H-indazole | 290368-00-2 | 2A-9074452 |
| 5-[(5-Bromo-pyridin-2-ylamino)-methylene]-2,2-dimethyl-[1,3]dioxane-4,6-dione | 25165-70-2 | 2A-9074461 |
| 5-BROMO-2-(2-METHYL-1,3-DIOXOLAN-2-YL)PYRIDINE | 214701-33-4 | 2A-9074466 |
| 4-(3-ISOPROPYL-1,2,4-OXADIAZOL-5-YL)PIPERIDINEHYDROCHLORIDE | 733751-26-3 | 2A-9074468 |
| 3-Bromo-4-oxo-piperidine-1-carboxylicacidtert-butylester | 188869-05-8 | 2A-9074480 |
| 2,2-Dibromo-1-furan-2-yl-ethanone | 17357-25-4 | 2A-9074481 |
| 2-Bromo-1-(5-methyl-furan-2-yl)-ethanone | 1634-53-3 | 2A-9074483 |
| 2-Bromo-1-furan-2-yl-ethanone | 15109-94-1 | 2A-0200188 |
| Furan-2-ylmethyl-(4-methyl-benzyl)-amine | 436099-83-1 | 2A-9074487 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA