
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 105211-78-7 |
| Catalog No. | 2A-9074266 |
| Chinese Name | 4-羟基-3-丙基苯甲酸甲酯 |
| Synonyms | methyl 4-hydroxy-3-propylbenzoate |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.22700 |
| Density | 1.109 g/cm3 |
| Boiling Point | 315.2ºC at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2918290000 |
| PubChem ID | 16919831 |
| SMILES | CCCc1cc(C(=O)OC)ccc1O |
| InChI | InChI=1S/C11H14O3/c1-3-4-8-7-9(11(13)14-2)5-6-10(8)12/h5-7,12H,3-4H2,1-2H3 |
| InChI Key | BBGUEJVSGMTLIT-UHFFFAOYSA-N |
| MSDS | msds/74266_1_105211_78_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl4-(3-Methylpiperazin-1-Ylmethyl)Benzoate | 914349-83-0 | 2A-9074253 |
| METHYL2-AMINO-5-CYANOBENZOATE | 159847-81-1 | 2A-9074254 |
| Methyl4-(5-Bromopyrimidin-2-Yloxy)Benzoate | 926304-76-9 | 2A-9074255 |
| Methyl4-[1,2,4]Triazol-1-Yl-Benzoate | 58419-67-3 | 2A-9074258 |
| 2-(5-Bromo-2-pyridylazo)-5-(diethylamino)phenol | 14337-53-2 | 2A-9074262 |
| Methyl4-Piperazin-1-Ylmethylbenzoate | 86620-81-7 | 2A-9074267 |
| Methyl5-Amino-2-Methylbenzoate | 18595-12-5 | 2A-9074268 |
| Methyl5-Bromo-2-Fluoronicotinate | 931105-37-2 | 2A-9074270 |
| 3-ETHYL-1-METHYL-4-PHENYL-1H-PYRAZOL-5-AMINE | 890014-40-1 | 2A-9074273 |
| Methyl6-Amino-5-Bromonicotinate | 180340-70-9 | 2A-9074274 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA