
CAS Number324769-07-5
Synonyms1-(tert-butoxycarbonyl)-2-ethyl-4-oxopiperidine; 2-Methyl-2-propanyl 2-ethyl-4-oxo-1-piperidinecarboxylate; 1-N-Boc-2-Ethylpiperidin-4-one; 2-ethyl-4-oxo-piperidine-1-carboxylic acid tert-butyl ester; 1-Piperidinecarboxylic acid, 2-ethyl-4-oxo-, 1,1-dimethylethyl ester; 1-Boc-2-ethylpiperidin-4-one
Molecular FormulaC12H21O3N1
Molecular Weight227.3
Density1.0±0.1 g/cm3
Boiling Point315.4±35.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 324769-07-5 |
| Catalog No. | 2A-9074226 |
| Chinese Name | 1-N-Boc-2-乙基哌啶-4-酮 |
| Synonyms | 1-(tert-butoxycarbonyl)-2-ethyl-4-oxopiperidine; 2-Methyl-2-propanyl 2-ethyl-4-oxo-1-piperidinecarboxylate; 1-N-Boc-2-Ethylpiperidin-4-one; 2-ethyl-4-oxo-piperidine-1-carboxylic acid tert-butyl ester; 1-Piperidinecarboxylic acid, 2-ethyl-4-oxo-, 1,1-dimethylethyl ester; 1-Boc-2-ethylpiperidin-4-one |
| Molecular Formula | C12H21O3N1 |
| Molecular Weight | 227.3 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 315.4±35.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933399090 |
| PubChem ID | 39215400 |
| MDL Number | MFCD07367729 |
| SMILES | CCC1CC(=O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21NO3/c1-5-9-8-10(14)6-7-13(9)11(15)16-12(2,3)4/h9H,5-8H2,1-4H3 |
| InChI Key | GJZHXLNQQNAXNW-UHFFFAOYSA-N |
| MSDS | msds/74226_1_324769_07_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Biotechnology & Diagnostics | ||
|---|---|---|
| 1-Boc-2-Benzylpiperidin-4-one | 193480-28-3 | 2A-9074199 |
| 1-Boc-2-trifluromethyl-piperidin-4-one | 1245648-32-1 | 2A-9074204 |
| 1-Boc-2-tert-Butylpiperidin-4-one | 362704-50-5 | 2A-9074205 |
| 1-Boc-2-isopropylpiperidin-4-one | 313950-41-3 | 2A-9074211 |
| 1-Boc-2-propylpiperidin-4-one | 1245643-80-4 | 2A-9074218 |
| Methyl2-Boc-Aminothiazole-4-Carboxylate | 850429-62-8 | 2A-9074227 |
| 1-Boc-2-Methylpiperidin-4-one | 190906-92-4 | 2A-9074230 |
| Methyl4-Boc-Aminothiophene-3-Carboxylate | 161940-20-1 | 2A-9074260 |
| (2-BOC-AMINOPHENYL)BORONICACID | 115377-94-1 | 2A-9074290 |
| (3-BOC-AMINOPHENYL)BORONICACID | 380430-68-2 | 2A-9074291 |
| Browse all Biotechnology & Diagnostics products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA