CAS Number40359-34-0
SynonymsAcetic acid, 2-(2-formylphenoxy)-, methyl ester; 2-(methoxycarbonylmethyloxy)benzaldehyde; Methyl (2-formylphenoxy)acetate; Methyl 2-(2-formylphenoxy)acetate; (2-formyl-phenoxy)-acetic acid methyl ester; methyl o-formylphenoxyacetate; (2-Formyl-phenoxy)-essigsaeure-methylester; BB_SC-5741
Molecular FormulaC10H10O4
Molecular Weight194.19
Density1.2±0.1 g/cm3
Boiling Point307.9±17.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 40359-34-0 |
| Catalog No. | 2A-9074210 |
| Chinese Name | (2-甲酰基苯氧基)乙酸甲酯 |
| Synonyms | Acetic acid, 2-(2-formylphenoxy)-, methyl ester; 2-(methoxycarbonylmethyloxy)benzaldehyde; Methyl (2-formylphenoxy)acetate; Methyl 2-(2-formylphenoxy)acetate; (2-formyl-phenoxy)-acetic acid methyl ester; methyl o-formylphenoxyacetate; (2-Formyl-phenoxy)-essigsaeure-methylester; BB_SC-5741 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 307.9±17.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, inert gas atmosphere |
| HTC | 2918990090 |
| PubChem ID | 7646166 |
| SMILES | COC(=O)COc1ccccc1C=O |
| InChI | InChI=1S/C10H10O4/c1-13-10(12)7-14-9-5-3-2-4-8(9)6-11/h2-6H,7H2,1H3 |
| InChI Key | BRNZMMUFVVXGGN-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Phenyl-4-piperidinone-HCl | 193201-69-3 | 2A-9074202 |
| 1-Cbz-2-phenylpiperidin-4-one | 335266-05-2 | 2A-9074203 |
| Manidipine | 89226-50-6 | 2A-9074206 |
| 2-tert-Butylpiperidin-4-oneHCl | 1245648-49-0 | 2A-9074207 |
| Methyl(2-Amino-Phenyl)-Acetate | 35613-44-6 | 2A-9074209 |
| Methyl(4-Formylphenoxy)Acetate | 73620-18-5 | 2A-9074212 |
| 2-Isopropylpiperidin-4-oneHCl | 362707-26-4 | 2A-9074213 |
| 1-Cbz-2-isopropylpiperidin-4-one | 952183-52-7 | 2A-9074216 |
| Methyl2-Acetylamino-3-Dimethylaminopropenoate | 188561-56-0 | 2A-9074220 |
| 2-Propylpiperidin-4-oneHCl | 59663-72-8 | 2A-9074221 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS