
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 49701-79-3 |
| Catalog No. | 2A-9073856 |
| Chinese Name | 2-氨基-3,4-二甲氧基苯乙酮 |
| Synonyms | 1-(2-Amino-3,4-dimethoxyphenyl)ethanone |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 331.0±37.0 °C at 760 mmHg |
| Storage Condition | Store at room temperature, protected from light, a |
| HTC | 2922509090 |
| PubChem ID | 33284710 |
| SMILES | COc1ccc(C(C)=O)c(N)c1OC |
| InChI | InChI=1S/C10H13NO3/c1-6(12)7-4-5-8(13-2)10(14-3)9(7)11/h4-5H,11H2,1-3H3 |
| InChI Key | VJXLBTQOYLNGRO-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Iodo-1-(4-methoxybenzyl)piperidin-2-one | 1245646-02-9 | 2A-9073844 |
| 3-Hydroxy-1-(4-methoxybenzyl)piperidin-2-one | 1245644-82-9 | 2A-9073849 |
| 3-Ethyl-pyridin-2-ylamine | 42753-67-3 | 2A-9073851 |
| 1-Piperidin-2-yl-ethanone | 97073-22-8 | 2A-9073853 |
| 1-Benzyl-2-oxopiperidin-3-ylacetate | 614754-21-1 | 2A-9073855 |
| 1-Benzyl-3-methyl-piperidin-4-ylaminedihydrochloride | 92309-62-1 | 2A-9073857 |
| 3-(4-Hydroxy-3-methoxyphenyl)propanoicacid | 1135-23-5 | 2A-9073859 |
| (4-Bromopyridin-2-yl)methanamine | 865156-50-9 | 2A-9073864 |
| 1-(4-Chloropyrimidin-2-yl)-4-piperidinol | 916791-08-7 | 2A-9073871 |
| 1-(4-Hydroxymethylphenyl)piperidin-4-ol | 914349-20-5 | 2A-9073874 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA