CAS Number68985-08-0
Synonyms2,4,6-Trimethyl-1,3-benzenedisulfonyl dichloride; 2,4,6-Trimethylbenzene-1,3-disulfonyl dichloride; 2,4,6-trimethylbenzene-1,3-disulfonyl chloride
Molecular FormulaC9H10Cl2O4S2
Molecular Weight317.21
Density1.5±0.1 g/cm3
Boiling Point428.1±45.0 °C at 760 mmHg
Melting Point125ºC
AppearanceSolid;White to Almost white powder to crystal
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 68985-08-0 |
| Catalog No. | 2A-9073792 |
| Chinese Name | 均三甲苯二磺酰氯 |
| Synonyms | 2,4,6-Trimethyl-1,3-benzenedisulfonyl dichloride; 2,4,6-Trimethylbenzene-1,3-disulfonyl dichloride; 2,4,6-trimethylbenzene-1,3-disulfonyl chloride |
| Molecular Formula | C9H10Cl2O4S2 |
| Molecular Weight | 317.21 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 428.1±45.0 °C at 760 mmHg |
| Melting Point | 125ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Soluble in: Toluene |
| Storage Condition | Store under inert gas; avoid moisture (decompositi |
| Packaging | III |
| HTC | 2904909090 |
| PubChem ID | 4930025 |
| SMILES | Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C9H10Cl2O4S2/c1-5-4-6(2)9(17(11,14)15)7(3)8(5)16(10,12)13/h4H,1-3H3 |
| InChI Key | LNXKRGBQKLXFTB-UHFFFAOYSA-N |
| Hazard Symbols | Category 8 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3261 Proper shipping name: Corrosive solid, acidic, organic, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (7-Benzyloxyindol-1-yl)aceticacid | 914349-77-2 | 2A-9073769 |
| 4-BOCAMINO-NICOTINICACID | 171178-34-0 | 2A-9073772 |
| (3-Methylisoxazol-5-yl)methylamine | 154016-55-4 | 2A-9073777 |
| 5-Aminopiperidin-2-one | 154148-70-6 | 2A-9073783 |
| 4-(4-Methylpiperazin-1-yl)cyclohexanone | 155778-84-0 | 2A-9073790 |
| TCA-O-PCPTrichloroaceticacidpentachlorophenylester | 2879-60-9 | 2A-9073796 |
| ALOC-OSUAllyloxycarbonylsuccinimidylester | 135544-68-2 | 2A-9073804 |
| PNZ-ONb | 193269-82-8 | 2A-9073805 |
| Ethyl3-(piperidin-4-yl)propanoatehydrochloride | 473987-06-3 | 2A-9073806 |
| 4-[4-(Dimethylamino)phenylazo]benzoicacidN-succinimidylester | 146998-31-4 | 2A-9073807 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS