
CAS Number1461-96-7
SynonymsCyclopentane-1,2-dicarboxylic acid; (1R,2S)-cyclopentane-1,2-dicarboxylic acid; 1,2-Cyclopentanedicarboxylic acid
Molecular FormulaC7H10O4
Molecular Weight158.15
Purity≥97.0 (GC)%
Density1.4±0.1 g/cm3
Boiling Point378.6±35.0 °C at 760 mmHg
Melting Point132-136 °C
Appearancecrystals
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1461-96-7 |
| Catalog No. | 2A-9073544 |
| Chinese Name | 顺式-1,2-环戊烷二甲酸 |
| Synonyms | Cyclopentane-1,2-dicarboxylic acid; (1R,2S)-cyclopentane-1,2-dicarboxylic acid; 1,2-Cyclopentanedicarboxylic acid |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 |
| Purity | ≥97.0 (GC) |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 378.6±35.0 °C at 760 mmHg |
| Melting Point | 132-136 °C |
| Appearance | crystals |
| Storage Condition | room temperature |
| HTC | 2917209090 |
| PubChem ID | 329764375 |
| MDL Number | MFCD01311172 |
| SMILES | OC(=O)[C@H]1CCC[C@H]1C(O)=O |
| InChI | 1S/C7H10O4/c8-6(9)4-2-1-3-5(4)7(10)11/h4-5H,1-3H2,(H,8,9)(H,10,11)/t4-,5+ |
| InChI Key | ASJCSAKCMTWGAH-SYDPRGILSA-N |
| Beilstein/REAXYS | 2049007 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/73544_1_1461_96_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-amino-4-methoxy-4-oxobutanoicacidhydrochloride | 1835-52-5 | 2A-9073524 |
| N-(4-acetyl-3-methylphenyl)acetamide | 34956-31-5 | 2A-9073528 |
| Cyclobutane-1,3-dicarboxylicacid | 2398-16-5 | 2A-9073537 |
| 3,4-dimethyl-1H-pyrazol-5-amine | 91159-73-8 | 2A-9073539 |
| Pyrimido[1,2-a]azepine,decahydro- | 25739-48-4 | 2A-9073543 |
| 2H-Azepin-2-one,3-aminohexahydro- | 671-42-1 | 2A-9073545 |
| 3-Morpholinone,4-phenyl- | 29518-11-4 | 2A-9073549 |
| 4-tert-butyl-1H-imidazol-2-amine | 82560-19-8 | 2A-9073552 |
| 1-benzyl-5-hydroxypiperidin-2-one | 913566-51-5 | 2A-9073562 |
| 1,1'-Bis(diphenylphosphino)ferrocene-palladium(II)dichloridedichloromethanecomplex | 95464-05-4 | 2A-0200885 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA