
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17672-21-8 |
| Catalog No. | 2A-9073516 |
| Chinese Name | 2-氨基-3-羟基苯甲酸甲酯 |
| Synonyms | Benzoic acid, 2-amino-3-hydroxy-, methyl ester; Methyl 2-amino-3-hydroxybenzoate |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 309.6±27.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2922509090 |
| PubChem ID | 840117 |
| SMILES | COC(=O)c1cccc(O)c1N |
| InChI | InChI=1S/C8H9NO3/c1-12-8(11)5-3-2-4-6(10)7(5)9/h2-4,10H,9H2,1H3 |
| InChI Key | GDIJXOCHGFQHCT-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-amino-3-iodo-4-methylbenzoicacid | 882679-23-4 | 2A-9073501 |
| 3-amino-4-methyl-2-nitrobenzoicacid | 37901-90-9 | 2A-9073505 |
| 5-Phenyl-2H-pyrazol-3-ylamine | 827-41-8 | 2A-9073509 |
| Biphenyl-2-carboxylicacid | 103863-14-5 | 2A-9073512 |
| 5-bromo-2-chlorophenol | 183802-98-4 | 2A-9073514 |
| methyl3-hydroxy-2-nitrobenzoate | 89942-77-8 | 2A-9073517 |
| methyl4-amino-3-nitrobenzoate | 3987-92-6 | 2A-9073519 |
| 3-(7-chloro-1-oxoisoindolin-2-yl)benzoicacid | 1044921-12-1 | 2A-9073523 |
| 2-amino-4-methoxy-4-oxobutanoicacidhydrochloride | 1835-52-5 | 2A-9073524 |
| N-(4-acetyl-3-methylphenyl)acetamide | 34956-31-5 | 2A-9073528 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA