
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16414-34-9 |
| Catalog No. | 2A-9073506 |
| Chinese Name | 6-溴-2_3-二羟基苯甲醛 |
| Synonyms | 3-bromo-4,5-dihydroxybenzaldehyde |
| Molecular Formula | C7H5BrO3 |
| Molecular Weight | 217.02 |
| Density | 1.901g/cm3 |
| Boiling Point | 297.4ºC at 760mmHg |
| Storage Condition | room temperature |
| HTC | 2913000090 |
| PubChem ID | 426010 |
| SMILES | O=Cc1cc(O)c(O)c(Br)c1 |
| InChI | InChI=1S/C7H5BrO3/c8-5-1-4(3-9)2-6(10)7(5)11/h1-3,10-11H |
| InChI Key | GVSGSHGXUXLQNS-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1-(4-methyl-2-(4-(trifluoromethyl)phenyl)thiazol-5-yl)ethanol | 438577-62-9 | 2A-9073319 |
| 1-(4-methyl-2-(4-(trifluoromethyl)phenyl)thiazol-5-yl)ethanone | 447406-53-3 | 2A-9073321 |
| 2-(chloromethyl)pyrimidin-4-ol | 944905-88-8 | 2A-9073414 |
| 8-bromo-2,3-dihydrobenzo[b][1,4]dioxine-6-carbaldehyde | 860003-88-9 | 2A-9073434 |
| 5-fluoro-6-methylpicolinaldehyde | 884495-34-5 | 2A-9073458 |
| 2-Methyl-1-trifluoromethyl-propylamine | 1582-18-9 | 2A-9073510 |
| Methyl(E)-3-methoxy-2-(2-chloromethylphenyl)-2-propenoate | 117428-51-0 | 2A-9073556 |
| 3-TERT-BUTYL-2-HYDROXYBENZALDEHYDE | 24623-65-2 | 2A-9073558 |
| 4-(3,9-diazaspiro[5.5]undecan-3-yl)benzonitrile | 352445-68-2 | 2A-9073565 |
| 3-phenyl-3,9-diazaspiro[5.5]undecane | 959490-93-8 | 2A-9073568 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA