
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 605-03-8 |
| Catalog No. | 2A-9073396 |
| Chinese Name | 4-苯基喹啉 |
| Synonyms | 4-phenylquinoline |
| Molecular Formula | C15H11N |
| Molecular Weight | 205.26 |
| Density | 1.127g/cm3 |
| Boiling Point | 353.3ºC at 760 mmHg |
| Melting Point | 61-62ºC |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933499090 |
| PubChem ID | 8671716 |
| SMILES | c1ccc(-c2ccnc3ccccc23)cc1 |
| InChI | InChI=1S/C15H11N/c1-2-6-12(7-3-1)13-10-11-16-15-9-5-4-8-14(13)15/h1-11H |
| InChI Key | LOCUXGFHUYBUHF-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Pyridine,4-(1-methyl-1H-pyrazol-4-yl)- | 870863-00-6 | 2A-9073369 |
| 1H-Benzimidazole-5-carboxylicacid,2,3-dihydro-2-oxo-,methylester | 106429-57-6 | 2A-9073383 |
| Pyridine,3-(4-methoxyphenyl)- | 5958-02-1 | 2A-9073388 |
| 2-Pyridinecarboxamide,N-[2-(methylthio)phenyl]- | 794582-15-3 | 2A-9073389 |
| 1-allyl-1H-benzo[d][1,2,3]triazole | 52298-91-6 | 2A-9073395 |
| 2-methyl-4-(3-nitrophenyl)pyrimidine | 874774-08-0 | 2A-9073400 |
| 2-methyl-4-(4-nitrophenyl)pyrimidine | 874773-94-1 | 2A-9073402 |
| 4-(3-fluorophenyl)-2-methylpyrimidine | 85979-50-6 | 2A-9073404 |
| 4-(4-fluorophenyl)-2-methylpyrimidine | 85979-51-7 | 2A-9073405 |
| 2-methyl-4-p-tolylpyrimidine | 19927-61-8 | 2A-9073406 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA