
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1659-31-0 |
| Catalog No. | 2A-9073285 |
| Chinese Name | 碳酸二-2-吡啶酯 |
| Synonyms | MFCD00191407; Di-2-pyridyl Carbonate; CARBONIC ACID DI-2-PYRIDYL ESTER; Di-2-pyridinyl carbonate; dipyridin-2-yl carbonate |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.2 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 351.6±17.0 °C at 760 mmHg |
| Melting Point | 90 °C |
| Storage Condition | Sealed and refrigerated |
| HTC | 2933399090 |
| PubChem ID | 3183999 |
| SMILES | O=C(Oc1ccccn1)Oc1ccccn1 |
| InChI | InChI=1S/C11H8N2O3/c14-11(15-9-5-1-3-7-12-9)16-10-6-2-4-8-13-10/h1-8H |
| InChI Key | GCSAXWHQFYOIFE-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| TFFHFluoro-N,N,N,N,-tetramethylformamidiniumhexafluorophosphate | 164298-23-1 | 2A-9073263 |
| Pentafluorophenyldiphenylphosphinate | 138687-69-1 | 2A-9073273 |
| N-tert-butyl-5-methylisoxazoliumperchlorate | 16965-08-5 | 2A-9073274 |
| Dimesitylammoniumpentafluorobenzenesulfonate | 850629-65-1 | 2A-9073278 |
| N,N-Diphenyl-4-methoxybenzamide | 16034-40-5 | 2A-9073282 |
| 6-chloro-4-oxo-1,2,3,4-tetrahydronaphthalene-2-carboxylicacid | 1661-98-9 | 2A-9073286 |
| N-(4-fluorobenzyl)-1-methylpiperidin-4-amine | 359878-47-0 | 2A-9073287 |
| 1-(3,4-dimethylphenyl)-3-methyl-3-pyrazolin-5-one | 18048-64-1 | 2A-9073289 |
| N-(4-(4,6-dichloropyrimidin-2-ylthio)phenyl)cyclopropanecarboxamide | 639090-53-2 | 2A-9073290 |
| N-(4-(4-chloro-6-(3-methyl-1H-pyrazol-5-ylamino)pyrimidin-2-ylthio)phenyl)cyclopropanecarboxamide | 639090-55-4 | 2A-9073291 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA