CAS Number146474-00-2
SynonymsMFCD01073617; N-(2-Aminoethyl)maleimide trifluoroacetic acid salt; 1-(2-aminoethyl)pyrrole-2,5-dione,2,2,2-trifluoroacetic acid; 1-(2-Aminoethyl)-1H-pyrrole-2,5-dione trifluoroacetate (1:1); 2-Maleimidoethylamine trifluoroacetate salt; N-(2-AMINOETHYL)MALEIMIDETRIFLUOROACETA
Molecular FormulaC8H9F3N2O4
Molecular Weight254.16
Purity≥95 (HPLC)%
Boiling Point278.1ºC at 760 mmHg
Melting Point124ºC
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 146474-00-2 |
| Catalog No. | 2A-9073241 |
| Chinese Name | N-(2-氨基乙基)马来酰亚胺 三氟乙酸盐 |
| Synonyms | MFCD01073617; N-(2-Aminoethyl)maleimide trifluoroacetic acid salt; 1-(2-aminoethyl)pyrrole-2,5-dione,2,2,2-trifluoroacetic acid; 1-(2-Aminoethyl)-1H-pyrrole-2,5-dione trifluoroacetate (1:1); 2-Maleimidoethylamine trifluoroacetate salt; N-(2-AMINOETHYL)MALEIMIDETRIFLUOROACETA |
| Molecular Formula | C8H9F3N2O4 |
| Molecular Weight | 254.16 |
| Purity | ≥95 (HPLC) |
| Boiling Point | 278.1ºC at 760 mmHg |
| Melting Point | 124ºC |
| Appearance | powder |
| Storage Condition | Store airtight in a cool, dry warehouse. |
| Application | Mal-NH2 (TFA) is a PROTAC linker, belonging to the alkyl chain class. Can be used to synthesize PROTAC molecules. |
| HTC | 2925190090 |
| PubChem ID | 57651612 |
| MDL Number | MFCD01073617 |
| SMILES | OC(C(F)(F)F)=O.O=C1N(CCN)C(C=C1)=O |
| InChI | 1S/C6H8N2O2.C2HF3O2/c7-3-4-8-5(9)1-2-6(8)10;3-2(4,5)1(6)7/h1-2H,3-4,7H2;(H,6,7) |
| InChI Key | YNHKVOGCDPODMT-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12161502 |
| MSDS | msds/73241_1_146474_00_2.pdf |
| Bioactivity | Chemical & Physical Properties |
| Use of | Mal-NH2 (TFA) is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Properties Biological Activity Chemical & Physical Properties |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sodium3-methyoxy-3-oxopropane-1-sulfinate | 90030-48-1 | 2A-9073223 |
| Dimethyl5-iodosophthalate | 51839-15-7 | 2A-9073225 |
| Methyl2-Fluoroisobutyrate | 338-76-1 | 2A-9073229 |
| Benzoicacid,4-[(1,2,2-trifluoroethenyl)oxy] | 134151-66-9 | 2A-9073232 |
| (E)-1-(2-(3-methoxystyryl)phenoxy)-3-(dimethylamino)propan-2-ol | 135261-74-7 | 2A-9073236 |
| 2-Chloro-4-nitrobenzotrifluoride | 151504-80-2 | 2A-9073244 |
| 1-(Hydroxymethyl)cyclopropaneacetonitrile | 152922-71-9 | 2A-9073246 |
| 5,7-dimethylindolin-2-one | 729598-50-9 | 2A-9073248 |
| 6-bromoquinazolin-2-amine | 791626-58-9/190273-89-3 | 2A-9073251 |
| AOP7-Azabenzotriazol-1-yloxytris(dimethyamino)phosphoniumhexafluorosphate | 156311-85-2 | 2A-9073252 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS