CAS Number154477-54-0
SynonymsMethyl 2-[4-(4-chlorobutanoyl)phenyl]-2-methylpropanoate; Benzeneacetic acid, 4-(4-chloro-1-oxobutyl)-α,α-dimethyl-, methyl ester; MFCD04973965; Methyl 2-(4-(4-chlorobutanoyl)phenyl)-2-methylpropanoate; Methyl-4-(4-chloro-1-oxobutyl)-alpha
Molecular FormulaC15H19ClO3
Molecular Weight282.76
Density1.1±0.1 g/cm3
Boiling Point396.5±32.0 °C at 760 mmHg
Appearancelight brown oily lump
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 154477-54-0 |
| Catalog No. | 2A-9073214 |
| Chinese Name | 2-[4-(4-氯-1-丁酰基)苯基]-2-甲基丙酸甲酯 |
| Synonyms | Methyl 2-[4-(4-chlorobutanoyl)phenyl]-2-methylpropanoate; Benzeneacetic acid, 4-(4-chloro-1-oxobutyl)-α,α-dimethyl-, methyl ester; MFCD04973965; Methyl 2-(4-(4-chlorobutanoyl)phenyl)-2-methylpropanoate; Methyl-4-(4-chloro-1-oxobutyl)-alpha |
| Molecular Formula | C15H19ClO3 |
| Molecular Weight | 282.76 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 396.5±32.0 °C at 760 mmHg |
| Appearance | light brown oily lump |
| Storage Condition | room temperature |
| HTC | 2918300090 |
| PubChem ID | 15046855 |
| MDL Number | MFCD22677268 |
| SMILES | COC(=O)C(C)(C)c1ccc(C(=O)CCCCl)cc1 |
| InChI | InChI=1S/C15H19ClO3/c1-15(2,14(18)19-3)12-8-6-11(7-9-12)13(17)5-4-10-16/h6-9H,4-5,10H2,1-3H3 |
| InChI Key | ULWORPZJUIFPIC-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 12352200 |
| MSDS | msds/73214_1_154477_54_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl3-methylamino-4,4,4-trifluorocrotonate | 121303-76-2 | 2A-9073206 |
| Trans-4-Aminocyclohexanol | 50910-58-5 | 2A-9073207 |
| Hydrazinecarboxylicacid,[[4-(2-pyridinyl)phenyl]methylene]-,1,1-dimethylethylester | 198904-84-6 | 2A-9073209 |
| 4-Chloro-2-(trifluoroacetyl)anilinehydrochloride | 173676-59-0 | 2A-9073211 |
| Delta-9,10-canrenone | 95716-71-5 | 2A-9073212 |
| Trans-4-Cyclohexyl-L-prolinemonohydro-chloride | 90657-55-9 | 2A-9073217 |
| 4-Amino-5-chloro-2-ethoxybenzoicacid | 20896-27-9 | 2A-9073218 |
| 1,2-diamino-2-methylpropane | 811-93-8 | 2A-9073219 |
| Sodium3-methyoxy-3-oxopropane-1-sulfinate | 90030-48-1 | 2A-9073223 |
| Dimethyl5-iodosophthalate | 51839-15-7 | 2A-9073225 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS