
CAS Number39560-31-1
Synonymsmethyl 4-(4-fluorophenyl)-4-oxo-butyrate; Methyl4-(4-Fluorophenyl)-4-oxobutanoate; 4-(4-fluorophenyl)-4-oxobutyric acid methyl ester; methyl 3-(p-fluorobenzoyl)propionate; methyl 3-(4-fluorobenzoyl)-propionate
Molecular FormulaC11H11FO3
Molecular Weight210.207
Density1.179g/cm3
Boiling Point315.7ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39560-31-1 |
| Catalog No. | 2A-9073110 |
| Chinese Name | 4-(4-氟苯基)-4-氧代丁酸甲酯 |
| Synonyms | methyl 4-(4-fluorophenyl)-4-oxo-butyrate; Methyl4-(4-Fluorophenyl)-4-oxobutanoate; 4-(4-fluorophenyl)-4-oxobutyric acid methyl ester; methyl 3-(p-fluorobenzoyl)propionate; methyl 3-(4-fluorobenzoyl)-propionate |
| Molecular Formula | C11H11FO3 |
| Molecular Weight | 210.207 |
| Density | 1.179g/cm3 |
| Boiling Point | 315.7ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918300090 |
| PubChem ID | 7660423 |
| MDL Number | MFCD03090514 |
| SMILES | COC(=O)CCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H11FO3/c1-15-11(14)7-6-10(13)8-2-4-9(12)5-3-8/h2-5H,6-7H2,1H3 |
| InChI Key | WVLOAJPINXKMAW-UHFFFAOYSA-N |
| MSDS | msds/73110_1_39560_31_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-cyanopicolinicacid | 53234-55-2 | 2A-9073101 |
| 5-cyanopicolinamide | 65346-04-5 | 2A-9073103 |
| 2-bromobutanenitrile | 41929-78-6 | 2A-9073104 |
| methyl5-hydroxypicolinate | 30766-12-2 | 2A-9073108 |
| EthylMethanesulfonylacetate | 4455-15-6 | 2A-9073109 |
| 2,6-Dinitrobenzonitrile | 35213-00-4 | 2A-9073111 |
| 2-Amino-6-bromobenzonitrile | 77326-62-6 | 2A-9073112 |
| 4-(1,3-Dioxolan-2-yl)aniline | 19073-14-4 | 2A-9073113 |
| 6-Amino-3,3-dimethylindolin-2-one | 100510-65-4 | 2A-9073114 |
| 2-(5-Aminopyridin-2-yl)-2-methylpropanenitrile | 1226776-95-9 | 2A-9073119 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA