
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5722-93-0 |
| Catalog No. | 2A-9073091 |
| Chinese Name | 2-羟基-4,5-二甲氧基苯甲酸 |
| Synonyms | 2-Hydroxy-4,5-dimethoxybenzoic acid |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.18 |
| Purity | 98% |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 361.5±42.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| PubChem ID | 16666835 |
| SMILES | COc1cc(O)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C9H10O5/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4,10H,1-2H3,(H,11,12) |
| InChI Key | RUBXSZYVSFYJQR-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-tert-Butyl-N-(6-chloro-5-(2-methoxyphenoxy)-2,2'-bipyrimidin-4-yl)benzenesulfonamide | 150727-06-3 | 2A-9073020 |
| 4-Pyridinamine,2-chloro-5-iodo- | 28712-49-4 | 2A-9073051 |
| N10-(Trifluoroacetyl)pteroicacid | 37793-53-6 | 2A-0201989 |
| (1,1-Dioxo-tetrahydrothiophen-3-yl)methylamine | 51070-55-4 | 2A-9073061 |
| 4-(4,6-dichloropyrimidin-2-ylamino)benzonitrile | 329187-59-9 | 2A-9073086 |
| 2-Bromo-1-[3,5-di(tert-butyl)-4-hydroxyphenyl]ethan-1-one | 14386-64-2 | 2A-9073092 |
| (E)-3-(4-amino-3,5-dimethylphenyl)acrylonitrileHCl | 661489-22-2 | 2A-9073094 |
| 7-(4-Bromobenzoyl)-1,3-dihydro-2H-indol-2-one | 91713-91-6 | 2A-9073095 |
| 4-methoxy-3,5-dimethylbenzonitrile | 152775-45-6 | 2A-9073098 |
| (4-chlorophenyl)(4-(trifluoromethoxy)phenyl)methanone | 87996-55-2 | 2A-9073099 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA