
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 154598-53-5 |
| Catalog No. | 2A-9072962 |
| Chinese Name | 1-(2-氨基-5-氯苯基)-2,2,2-三氟乙烷酮 |
| Synonyms | 1-(2-Amino-5-chlorophenyl)-2,2,2-trifluoroethanone; 2-trifluoroacetyl-4-chloro aniline |
| Molecular Formula | C8H5O1N1Cl1F3 |
| Molecular Weight | 223.58 |
| Density | 1.475g/cm3 |
| Boiling Point | 282.279°C at 760 mmHg |
| Melting Point | 90-91°C |
| Appearance | yellow solid |
| Storage Condition | room temperature |
| HTC | 2922399090 |
| PubChem ID | 16046320 |
| MDL Number | MFCD08458216 |
| SMILES | Nc1ccc(Cl)cc1C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H5ClF3NO/c9-4-1-2-6(13)5(3-4)7(14)8(10,11)12/h1-3H,13H2 |
| InChI Key | NOKSRMDODJGCPZ-UHFFFAOYSA-N |
| MSDS | msds/72962_1_154598_53_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| DL-4-AMINO-3-HYDROXYBUTYRICACID[GABOB] | 924-49-2 | 2A-9072952 |
| 2-Amino-5-Bromo-3-Nitrobenzotrifluoride | 157026-18-1 | 2A-9072956 |
| 3-Fluorophenylmagnesiumbromide | 17318-03-5 | 2A-9072958 |
| 1-Butoxy-2,3-Difluorobenzene | 136239-66-2 | 2A-9072959 |
| 4-(Difluoromethoxy)BenzylAlcohol | 170924-50-2 | 2A-9072960 |
| dimethyl-2-(pyrimidin-4-yl)malonate | 86761-91-3 | 2A-9072967 |
| ETHYL2-(4-HYDROXYPYRIMIDIN-5-YL)ACETATE | 6214-46-6 | 2A-9072968 |
| ethyl2-(4-chloropyrimidin-5-yl)acetate | 6214-47-7 | 2A-9072969 |
| 1,2,4-triazin-3-amine | 184433-61-2 | 2A-9072971 |
| 2-Bromo-6-tert-butyl-4-(1,1-dimethoxyethyl)anisole | 153356-10-6 | 2A-9072972 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA