
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 297773-45-6 |
| Catalog No. | 2A-9072883 |
| Chinese Name | (S)-叔丁氧羰基-3-(3-吡啶基)-β-丙氨酸 |
| Synonyms | MFCD03427910; (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-3-ylpropanoic acid |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 200.28 |
| Purity | ≥98.0 (TLC) |
| Density | 1.198g/cm3 |
| Boiling Point | 455ºC at 760 mmHg |
| Storage Condition | Store airtight in a cool, dry warehouse. |
| Application | (S)-3-((tert-butoxycarbonyl)amino)-3-(pyridin-3-yl)propionic acid is an alanine derivative [1]. |
| HTC | 2933399090 |
| PubChem ID | 57647810 |
| MDL Number | MFCD03094718 |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](N)C1 |
| InChI | 1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-5-8(11)7-12/h8H,4-7,11H2,1-3H3/t8-/m0/s1 |
| InChI Key | AKQXKEBCONUWCL-QMMMGPOBSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352005 |
| MSDS | msds/72883_1_297773_45_6.pdf |
| Bioactivity | Chemical & Physical Properties |
| Use of | (S)-3-((tert-Butoxycarbonyl)amino)-3-(pyridin-3-yl)propanoic acid is an alanine derivative[1]. Properties Biological Activity Chemical & Physical Properties |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| Fmoc-(S)-3-Amino-3-(4-bromo-phenyl)-propionicacid | 220497-68-7 | 2A-9072875 |
| (R)-ß-(p-methylphenyl)alanine | 479064-87-4 | 2A-9072876 |
| 4-chloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine | 35808-68-5 | 2A-9072877 |
| FMOC-(R)-ß-(p-methylphenyl)alanine | 479064-98-7 | 2A-9072878 |
| FMOC-(S)-ß-(p-methylphenyl)alanine | 479064-99-8 | 2A-9072882 |
| (S)-3-Amino-3-(2-thienyl)-propionicacid | 131829-50-0 | 2A-9072884 |
| (R)-3-Amino-3-(1-naphthyl)-propionicacid | 775280-91-6 | 2A-9072885 |
| Boc-(R)-3-Amino-3-(1-naphthyl)-propionicacid | 500789-00-4 | 2A-9072886 |
| Fmoc-(R)-3-Amino-3-(1-naphthyl)-propionicacid | 511272-47-2 | 2A-9072887 |
| ethyl(R)-3-amino-3-(1-naphthyl)-propionate | 275826-40-9 | 2A-9072889 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA