
CAS Number4547-02-8
Synonyms7-chloro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepine-2-thione; 7-Chloro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepin-2-thione; BENZP-DINITRIDE-THIO-KETONE; 7-chloro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-thione; 7-Chlor-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepin-2-thion; 1,3-dihydro-5-phenyl-7-chloro-2H-1,4-benzodiazepine-2-thione; Benzodiazepines Intermediate 1
Molecular FormulaC15H11N2Cl1S1
Molecular Weight286.78
Density1.32 g/cm3
Boiling Point408.9ºC at 760 mmHg
Melting Point248-250ºC
Appearancelight yellow crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4547-02-8 |
| Catalog No. | 2A-9072744 |
| Chinese Name | 7-氯-1,3-二氢-5-苯基-2H-1,4-苯并二氮杂-2-硫酮 |
| Synonyms | 7-chloro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepine-2-thione; 7-Chloro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepin-2-thione; BENZP-DINITRIDE-THIO-KETONE; 7-chloro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-thione; 7-Chlor-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepin-2-thion; 1,3-dihydro-5-phenyl-7-chloro-2H-1,4-benzodiazepine-2-thione; Benzodiazepines Intermediate 1 |
| Molecular Formula | C15H11N2Cl1S1 |
| Molecular Weight | 286.78 |
| Density | 1.32 g/cm3 |
| Boiling Point | 408.9ºC at 760 mmHg |
| Melting Point | 248-250ºC |
| Appearance | light yellow crystal |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933990090 |
| PubChem ID | 8235819 |
| MDL Number | MFCD02068928 |
| SMILES | S=C1CN=C(c2ccccc2)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C15H11ClN2S/c16-11-6-7-13-12(8-11)15(17-9-14(19)18-13)10-4-2-1-3-5-10/h1-8H,9H2,(H,18,19) |
| InChI Key | ULILTJWAJZIROM-UHFFFAOYSA-N |
| MSDS | msds/72744_1_4547_02_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Acetylamino-3-(3,4,5-trifluoro-phenyl)-propionicacid | 324028-06-0 | 2A-9072725 |
| 3-Acetylamino-3-(4-fluoro-phenyl)propionicacid | 332052-58-1 | 2A-9072726 |
| 3-Acetylamino-3-phenylpropionicacid | 40638-98-0 | 2A-9072730 |
| Diethyl(4-(diphenylamino)benzyl)phosphonate | 126150-12-7 | 2A-9072741 |
| (2S)-(1-Tetrahydropyramid-2-one)-3-methylbutanoicacid | 192725-50-1 | 2A-9072743 |
| [4-(Dimethylamino)phenyl]diphenylphosphine | 739-58-2 | 2A-9072749 |
| Bis(benzonitrile)palladium(II)chloride | 14220-64-5 | 2A-9072752 |
| 4.8-Dihydrobenzo[1,2-b:4,5-b']dithiophen4,8-dione | 32281-36-0 | 2A-9072754 |
| 6-(4-methoxyphenyl)pyridazin-3-amine | 4776-87-8 | 2A-9072761 |
| 6-phenylpyridazin-3-amine | 14966-91-7 | 2A-9072763 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA