
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 114837-81-9 |
| Catalog No. | 2A-9072583 |
| Chinese Name | 3-(3-氧代丙基)苯甲酸乙酯 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.23800 |
| Boiling Point | 313.374ºC at 760 mmHg |
| HTC | 2918300090 |
| PubChem ID | 15266392 |
| SMILES | CCOC(=O)c1cccc(CCC=O)c1 |
| InChI | InChI=1S/C12H14O3/c1-2-15-12(14)11-7-3-5-10(9-11)6-4-8-13/h3,5,7-9H,2,4,6H2,1H3 |
| InChI Key | WDQKDAROHNRPOX-UHFFFAOYSA-N |
| MSDS | msds/72583_1_114837_81_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-(methylthio)pyrimido[5,4-d]pyrimidin-4-ol | 98550-19-7 | 2A-9072552 |
| Methanesulfonamide,N-(1-ethyl-1,2,3,4-tetrahydro-7-quinolinyl)-1,1,1-trifluoro- | 848080-31-9 | 2A-9072561 |
| (±)-3-(Carbamoylmethyl)-5-methylhexanoicacid | 181289-15-6 | 2A-9072576 |
| ethyl3-(but-3-enyl)benzoate | 731772-84-2 | 2A-9072579 |
| 2-Phenyldihydro-2H-pyran-4(3H)-one | 147688-62-8 | 2A-9072581 |
| potassiumallyltrifluoroborate | 233664-53-4 | 2A-9072585 |
| 4-amino-5,6-dihydropyridin-2(1H)-one | 1245643-32-6 | 2A-9072586 |
| tert-butylthiazol-5-ylcarbamate | 942631-50-7 | 2A-9072590 |
| benzylvinylcarbamate | 84713-20-2 | 2A-9072591 |
| 4-(isopropyldimethylsilyloxy)cyclohex-1-enyltrifluoromethanesulfonate | 1245648-54-7 | 2A-9072593 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA