
CAS Number91430-80-7
SynonymsN,N-dimethyl-3-(4-nitrophenoxy)propylamine; N,N-DIMETHYL-3-(-4-NITROPHENOXY)-1-PROPANAMINE; 4-(3-(dimethylamino)propoxy)nitrobenzene; N,N-dimethyl-3-(4-nitrophenoxy) propan-1-amine; N,N-Dimethyl-3-(4-nitrophenoxy)-1-propanamine
Molecular FormulaC11H16N2O3
Molecular Weight224.256
Density1.1±0.1 g/cm3
Boiling Point340.8±22.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 91430-80-7 |
| Catalog No. | 2A-9072462 |
| Chinese Name | N,N-二甲基-3-(4-硝基苯氧基)-1-丙胺 |
| Synonyms | N,N-dimethyl-3-(4-nitrophenoxy)propylamine; N,N-DIMETHYL-3-(-4-NITROPHENOXY)-1-PROPANAMINE; 4-(3-(dimethylamino)propoxy)nitrobenzene; N,N-dimethyl-3-(4-nitrophenoxy) propan-1-amine; N,N-Dimethyl-3-(4-nitrophenoxy)-1-propanamine |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.256 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 340.8±22.0 °C at 760 mmHg |
| HTC | 2922299090 |
| PubChem ID | 15365819 |
| SMILES | CN(C)CCCOc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H16N2O3/c1-12(2)8-3-9-16-11-6-4-10(5-7-11)13(14)15/h4-7H,3,8-9H2,1-2H3 |
| InChI Key | LZAUJKLXJFELOL-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Amino-4-(3-chloropropoxy)-5-methoxybenzonitrile | 1122661-16-8 | 2A-9072447 |
| 1-(4-Cyanophenyl)-5-methyl-1H-pyridin-2-one | 1198411-34-5 | 2A-9072448 |
| N,N-Dimethyl-4-(morpholin-2-yl)benzenamine | 1017417-87-6 | 2A-9072451 |
| Isopropyl2-aminoacetatehydrochloride | 14019-62-6 | 2A-9072458 |
| 4-Chloro-6,7-dimethoxy-1-methylquinolin-2(1H)-one | 878380-79-1 | 2A-9072461 |
| 5-Sulphosalicylicacid | 5965-83-5 | 2A-9072469 |
| 4-(Morpholin-2-yl)phenol | 103028-91-7 | 2A-9072470 |
| 3-(2-Oxopyrrolidin-1-yl)benzene-1-sulfonylchloride | 344312-54-5 | 2A-9072474 |
| 2-Methyl-5-nitrophenylguanidinenitrate | 152460-08-7 | 2A-9072475 |
| 4-Acetyl-3,4-dihydro-2H-benzo[b][1,4]oxazine-6-sulfonylchloride | 1017791-37-5 | 2A-9072476 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA