
CAS Number716-76-7
Synonyms3-Biphenylcarboxylic acid; Biphenyl-3-carboxylic acid; 3-phenylbenzoic acid; MFCD00045846; EINECS 211-938-7; [1,1'-Biphenyl]-3-carboxylic acid
Molecular FormulaC13H10O2
Molecular Weight266.22
Purity98%
Density1.2±0.1 g/cm3
Boiling Point392.2±21.0 °C at 760 mmHg
Melting Point164-169 °C
Appearancesolid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 716-76-7 |
| Catalog No. | 2A-9007236 |
| Chinese Name | 3-苯基苯甲酸 |
| Synonyms | 3-Biphenylcarboxylic acid; Biphenyl-3-carboxylic acid; 3-phenylbenzoic acid; MFCD00045846; EINECS 211-938-7; [1,1'-Biphenyl]-3-carboxylic acid |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 266.22 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 392.2±21.0 °C at 760 mmHg |
| Melting Point | 164-169 °C |
| Appearance | solid |
| Water Solubility | Insoluble |
| Storage Condition | Keep container tightly closed and stored in a cool |
| HTC | 2916399090 |
| UN(IATA) | UN 3077 9/PG 3 |
| PubChem ID | 329830298 |
| MDL Number | MFCD03424604 |
| SMILES | OC(C1=CC(C2=CC=C(C(F)(F)F)C=C2)=CC=C1)=O |
| InChI | 1S/C14H9F3O2/c15-14(16,17)12-6-4-9(5-7-12)10-2-1-3-11(8-10)13(18)19/h1-8H,(H,18,19) |
| InChI Key | BJKGBAVGLRYCTK-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S37/39 |
| MSDS | msds/7236_1_716_76_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Benzoic acid 3-bromomethylphenyl ester | 129250-89-1 | 2A-9007151 |
| Benzyl (2,2,2-trifluoro-1-trifluoromethylethylidene)carbamate | 128229-95-8 | 2A-9007167 |
| Biphenyl-3,3'-dicarboxylic acid 3-isopropyl ester | 728918-79-4 | 2A-9007232 |
| Biphenyl-3,4'-dicarboxylic acid 3-isopropyl ester | 282727-24-6 | 2A-9007233 |
| Biphenyl-3,4'-dicarboxylic acid 4'-isopropyl ester | 728919-00-4 | 2A-9007234 |
| Biphenyl-3-carboxylic acid ethyl ester | 6301-56-0 | 2A-9007237 |
| Biphenyl-4,4'-dicarboxylic acid | 787-70-2 | 2A-0200204 |
| Biphenyl-4,4'-dicarboxylic acid 4-isopropyl ester | 728918-98-7 | 2A-9007240 |
| Bis(diisopropyl-D-tartrateglycolato)diboron | 748142-39-4 | 2A-9007247 |
| Bis(diisopropyl-L-tartrateglycolato)diboron | 230299-10-2 | 2A-9007248 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA