
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 149554-06-3 |
| Catalog No. | 2A-9072321 |
| Chinese Name | 4-(4'-氰基苯基)哌啶 |
| Synonyms | 4-(piperidin-4-yl)benzonitrile; 4-(4-Piperidinyl)benzonitrile |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 333.6±42.0 °C at 760 mmHg |
| Storage Condition | Room temperature, protected from light, dry and se |
| HTC | 2933399090 |
| PubChem ID | 3184825 |
| SMILES | N#Cc1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C12H14N2/c13-9-10-1-3-11(4-2-10)12-5-7-14-8-6-12/h1-4,12,14H,5-8H2 |
| InChI Key | WIAZPDPJRACUDP-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-(3-Carboxyphenyl)piperidine | 766508-67-2 | 2A-9072303 |
| 4-(3-Chlorophenyl)piperidine | 99329-70-1 | 2A-9072304 |
| 4-(4-Aminophenyl)piperidine | 113310-52-4 | 2A-9072314 |
| 4-(4-Bromophenyl)-4-hydroxypiperidine | 57988-58-6 | 2A-9072316 |
| 4-(4-Carboxyphenyl)piperidine | 196204-01-0 | 2A-9072319 |
| 4-isopropyl-5-methylfuran-2-carbaldehyde | 1000993-65-6 | 2A-9072328 |
| 3-Chlorotetrahydrofuran | 19311-38-7 | 2A-9072333 |
| 1H-Benz[de]isoquinoline-2(3H)-butanamide,N-hydroxy-1,3-dioxo-(9CI) | 300816-11-9 | 2A-9072337 |
| 1H-Benz[de]isoquinoline-2(3H)-hexanamide,N-hydroxy-1,3-dioxo- | 287383-59-9 | 2A-9072338 |
| N-(tetrahydrofuran-3-yl)benzamide | 872303-09-8 | 2A-9072339 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA