
CAS Number1172229-72-9
Synonymsethyl 5-chloro-1-methylpyrazole-3-carboxylate; Ethyl 5-chloro-1-methyl-1H-pyrazole-3-carboxylate; 1H-Pyrazole-3-carboxylic acid, 5-chloro-1-methyl-, ethyl ester
Molecular FormulaC7H9O2N2Cl1
Molecular Weight188.61
Density1.3±0.1 g/cm3
Boiling Point274.3±20.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1172229-72-9 |
| Catalog No. | 2A-9072278 |
| Chinese Name | 5-氯-1-甲基-1H-吡唑-3-羧酸乙酯 |
| Synonyms | ethyl 5-chloro-1-methylpyrazole-3-carboxylate; Ethyl 5-chloro-1-methyl-1H-pyrazole-3-carboxylate; 1H-Pyrazole-3-carboxylic acid, 5-chloro-1-methyl-, ethyl ester |
| Molecular Formula | C7H9O2N2Cl1 |
| Molecular Weight | 188.61 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 274.3±20.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2933199090 |
| PubChem ID | 69453710 |
| MDL Number | MFCD10699191 |
| SMILES | CCOC(=O)c1cc(Cl)n(C)n1 |
| InChI | InChI=1S/C7H9ClN2O2/c1-3-12-7(11)5-4-6(8)10(2)9-5/h4H,3H2,1-2H3 |
| InChI Key | NZXVQPKDTOICGR-UHFFFAOYSA-N |
| MSDS | msds/72278_1_1172229_72_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 8-Methoxyquinoline-2-carbaldehyde | 103854-64-4 | 2A-9072260 |
| tert-Butyl4-(2-tert-butoxy-2-oxoethyl)piperazine-1-carboxylate | 180576-04-9 | 2A-9072261 |
| 2-cyclopropyl-6-phenylpyrazine | 1245648-40-1 | 2A-9072263 |
| 4-m-Tolylmorpholine | 7025-91-4 | 2A-9072266 |
| 2-Hydroxy-6-isobutylpyrimidine-4-carboxylicacid | 876715-59-2 | 2A-9072273 |
| 1-Methyl-4-piperidineaceticacid | 87647-06-1 | 2A-9072284 |
| 2-Aminopiperidinedihydrochloride | 45505-66-6 | 2A-9072286 |
| 2-Piperidinecarboxamide | 19889-77-1 | 2A-9072290 |
| 3-(Cbz-aminomethyl)piperidine | 478366-02-8 | 2A-9072292 |
| 3-Cyanopiperidine | 7492-88-8 | 2A-9072297 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA