
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 581-46-4 |
| Catalog No. | 2A-9072183 |
| Chinese Name | 3,3'-联吡啶 |
| Synonyms | 3-pyridin-3-ylpyridine |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.189 |
| Density | 1.106g/cm3 |
| Boiling Point | 291.5ºC at 760mmHg |
| Appearance | Liquid;Colorless to Light yellow to Light orange clear liquid |
| Storage Condition | Store in inert gas; protect from light, air |
| HTC | 2933399090 |
| PubChem ID | 609935 |
| MDL Number | MFCD00006371 |
| SMILES | c1cncc(-c2cccnc2)c1 |
| InChI | InChI=1S/C10H8N2/c1-3-9(7-11-5-1)10-4-2-6-12-8-10/h1-8H |
| InChI Key | OFDVABAUFQJWEZ-UHFFFAOYSA-N |
| MSDS | msds/72183_1_581_46_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-methyl-3,3‘-bipyridine | 38840-06-1 | 2A-9072166 |
| 5-chloro-3,3‘-bipyridine | 284040-67-1 | 2A-9072170 |
| 5-methoxy-3,3‘-bipyridine | 1190645-04-5 | 2A-9072174 |
| 3,3‘-bipyridine-5-carbonitrile | 1802-33-1 | 2A-9072178 |
| 3-Hydrazinopyridinehydrochloride | 650638-17-8 | 2A-9072180 |
| 2,2‘-dimethoxy-4,4‘-bipyridine | 142929-11-1 | 2A-9072186 |
| 3-(4-aminophenyl)-6-fluoro-7-(methylamino)quinazoline-2,4(1H,3H)-dione | 936501-00-7 | 2A-9072199 |
| 3-METHYL-5-(TRIFLUOROMETHYL)PYRAZOLE | 10010-93-2 | 2A-9072204 |
| 5-AMINO-1-(4-FLUOROPHENYL)-1H-PYRAZOLE-4-CARBOXYLICACID | 187949-90-2 | 2A-9072205 |
| cis-tetrahydro-1H-cyclopenta[c]furan-1,3(3aH)-dione | 35878-28-5 | 2A-9072224 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA