
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5467-53-8 |
| Catalog No. | 2A-9072080 |
| Chinese Name | 4-(4-乙基苯)丁酸 |
| Synonyms | 4-Ethylbenzenebutanoic acid; 4-(4-Ethylphenyl)butanoic acid |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.254 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 321.8±11.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2916399090 |
| PubChem ID | 88254 |
| SMILES | CCc1ccc(CCCC(=O)O)cc1 |
| InChI | InChI=1S/C12H16O2/c1-2-10-6-8-11(9-7-10)4-3-5-12(13)14/h6-9H,2-5H2,1H3,(H,13,14) |
| InChI Key | IDXWSFCOUZYCMF-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-naphthalene-2-sulfonicacid,sodiumsalt | 1017781-39-3 | 2A-9072063 |
| Cis-2-tert-butyl-2-butenedinitrile | 169309-80-2 | 2A-9072069 |
| Diethoxymethylacetate | 14036-61-0 | 2A-9072072 |
| [3-[4-Chloro-2-(2,6-difluorobenzoyl)phenyl]prop-2-ynyl]carbamicacidtert-butyl | 869366-03-0 | 2A-9072075 |
| 4-Ethylbenzenepropanoicacid | 64740-36-9 | 2A-9072077 |
| DL(±)-3-Amino-3-phenyl-propionicacid | 3646-50-2 | 2A-9072082 |
| 4-Amino-3,4-dihydro-2(1H)-quinolinone | 858783-30-9 | 2A-9072083 |
| IS(+)-3-BromoCamphor-10-Sulfonicacid(monohydrate) | 209736-59-4 | 2A-9072085 |
| 2-Fluoro-5-(chlorosulfonyl)benzoicacid | 37098-75-2 | 2A-9072087 |
| Cyclobutylhydrazine | 742673-64-9 | 2A-9072089 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA