
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 768-59-2 |
| Catalog No. | 2A-9072078 |
| Chinese Name | 4-乙基苄醇 |
| Synonyms | EINECS 212-198-8; (4-ethylphenyl)methanol; MFCD00004666 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 |
| Density | 1g/cm3 |
| Boiling Point | 241.8ºC at 760mmHg |
| Melting Point | 85-86.5℃ |
| Appearance | Transparent colorless liquid |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2906299090 |
| PubChem ID | 3138230 |
| SMILES | CCc1ccc(CO)cc1 |
| InChI | InChI=1S/C9H12O/c1-2-8-3-5-9(7-10)6-4-8/h3-6,10H,2,7H2,1H3 |
| InChI Key | YSLBFFIVJGJBSA-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 4-Ethylbenzyl alcohol |
| Related Products in Industrial Applications | ||
|---|---|---|
| (1S,trans)-2-hydroxymethylcyclohexane-carboxamide | 116174-40-4 | 2A-9071915 |
| trans-cyclohexane-1,3-diaminehydrochloride | 28294-92-0 | 2A-9071944 |
| (5-Aminobenzimidazol-2-yl)methanol | 294656-36-3 | 2A-9071955 |
| 1,1-Cyclohexanediaceticacidmonomethylester | 64142-94-1 | 2A-9071959 |
| 4-(2-Oxiranylmethoxy)-benzeneethanol | 104857-48-9 | 2A-9071974 |
| 3,5-Diacetoxytoluene | 20982-28-9 | 2A-9072158 |
| (3'-Methoxybiphenyl-4-yl)methanol | 81443-45-0 | 2A-9072163 |
| (4'-Chlorobiphenyl-4-yl)methanol | 22494-48-0 | 2A-9072169 |
| 2,3,5,6-Tetrafluoro-1,4-benzenedimethanol | 92339-07-6 | 2A-9072317 |
| 2-(benzo[d]thiazol-2-yl)ethanol | 46055-91-8 | 2A-9072327 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA