
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 28177-50-6 |
| Catalog No. | 2A-9072002 |
| Chinese Name | 2-氟-6-碘苯酚 |
| Synonyms | Phenol,2-fluoro-6-iodo; 2-fluoranyl-6-iodanyl-phenol; 2-fluoro-6-iodo-phenol; 2-Fluor-6-iod-phenol |
| Molecular Formula | C6H4FIO |
| Molecular Weight | 238 |
| Density | 2.085g/cm3 |
| Boiling Point | 169.319ºC at 760 mmHg |
| Melting Point | 16.1°C |
| Storage Condition | 2-8°C |
| HTC | 2908199090 |
| PubChem ID | 38370662 |
| SMILES | Oc1c(F)cccc1I |
| InChI | InChI=1S/C6H4FIO/c7-4-2-1-3-5(8)6(4)9/h1-3,9H |
| InChI Key | ZFARONFWYBCKDO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Plastic & Specialty Additives | ||
|---|---|---|
| tert-butyl3-iodopropylcarbamate | 167479-01-8 | 2A-9070619 |
| 5-Chloro-2-fluoro-4-iodopyridine | 659731-48-3 | 2A-9070726 |
| 2-Fluoro-3-iodophenylboronicacid | 1016231-39-2 | 2A-9071285 |
| Hexaphenoxycyclotriphosphazene | 1184-10-7 | 2A-9071759 |
| Methyl(3r)-3-(tert-butyldimethylsilyloxy)-5-oxo-6-triphenylphosphoranylidenehexanoate | 147118-35-2 | 2A-9071933 |
| (5-Chloro-2-iodophenyl)(2,6-difluorophenyl)methanone | 869365-97-9 | 2A-9072073 |
| chloro[2-[1-[(4-methylphenyl)imino]ethyl]ferrocenyl-C,N]triphenylphosphine)-Palladium | 155940-98-0 | 2A-9072136 |
| (Chloromethyl)triphenylphosphoniumchloride | 5293-84-5 | 2A-9072364 |
| N-TriphenylMethylC5-(2-bromophenyl)tetrazole | 143945-72-6 | 2A-9072492 |
| 2-Thienyltriphenylphosphoniumbromide | 23259-98-5 | 2A-9072757 |
| Browse all Plastic & Specialty Additives products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA