
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56759-32-1 |
| Catalog No. | 2A-9071932 |
| Chinese Name | 1-(4-氨基-3-溴-苯基)-乙酮 |
| Synonyms | 1-(4-Amino-3-bromophenyl)ethanone |
| Molecular Formula | C8H8BrNO |
| Molecular Weight | 214.06 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 344.1±27.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2922399090 |
| PubChem ID | 6378380 |
| SMILES | CC(=O)c1ccc(N)c(Br)c1 |
| InChI | InChI=1S/C8H8BrNO/c1-5(11)6-2-3-8(10)7(9)4-6/h2-4H,10H2,1H3 |
| InChI Key | ASMVJBACZFHISI-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl-2-t-butoxy-2-carboxylamino-3-nitrobenzoate | 136285-65-9 | 2A-9071925 |
| 4-Phenyl-1H-pyrazol-5-amine | 60523-82-2 | 2A-9071927 |
| 3-methoxy-3-oxopropanoicacid | 16695-14-0 | 2A-9071929 |
| 4-Phenyl-1H-pyrazol-5-amine | 57999-06-1 | 2A-9071930 |
| cis-N-(3-hydroxycyclohexyl)benzamide | 13941-94-1 | 2A-9071931 |
| trans-benzyl3-aminocyclohexylcarbamate | 1223158-00-6 | 2A-9071935 |
| Alpha-Bromo-2-ChlorophenylaceticAcid | 141109-25-3 | 2A-9071937 |
| cis-benzyl3-aminocyclohexylcarbamate | 1259278-12-0 | 2A-9071938 |
| 2-(Difluoromethoxy)-5-nitroaniline | 54939-58-1 | 2A-9071939 |
| 5-Chloro-2-methoxynicotinicacid | 54916-65-3 | 2A-9071942 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA