
CAS Number6178-42-3
Synonyms2-Methoxy-4-((E)-2-nitro-vinyl)-phenol; vanillalnitromethane; 2-Methoxy-4-(trans-2-nitro-vinyl)-phenol; AURORA 3504; MFCD00024827; 4-Hydroxy-3-methoxy-β-nitrostyrene; TRANS-2-METHOXY-4-(2-NITROVINYL)PHENOL; 12-Nitro-4-oxy-3-methoxy-1-vinyl-benzol; 1-(3-methoxy-4-hydroxyphenyl)-2-nitroethylene; Vanillylidennitromethan; 2-methoxy-4-[(E)-2-nitroethenyl]phenol; 2-METHOXY-4-(2-NITROVINYL)PHENOL; 2-Methoxy-4-[(E)-2-nitrovinyl]phenol; 4-HYDROXY-3-METHOXYNITROSTYRENE
Molecular FormulaC9H9NO4
Molecular Weight195.172
Density1.3±0.1 g/cm3
Boiling Point347.0±27.0 °C at 760 mmHg
Melting Point168-170 °C(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6178-42-3 |
| Catalog No. | 2A-9071923 |
| Chinese Name | 2-甲氧基-4-(2-硝基乙烯)酚 |
| Synonyms | 2-Methoxy-4-((E)-2-nitro-vinyl)-phenol; vanillalnitromethane; 2-Methoxy-4-(trans-2-nitro-vinyl)-phenol; AURORA 3504; MFCD00024827; 4-Hydroxy-3-methoxy-β-nitrostyrene; TRANS-2-METHOXY-4-(2-NITROVINYL)PHENOL; 12-Nitro-4-oxy-3-methoxy-1-vinyl-benzol; 1-(3-methoxy-4-hydroxyphenyl)-2-nitroethylene; Vanillylidennitromethan; 2-methoxy-4-[(E)-2-nitroethenyl]phenol; 2-METHOXY-4-(2-NITROVINYL)PHENOL; 2-Methoxy-4-[(E)-2-nitrovinyl]phenol; 4-HYDROXY-3-METHOXYNITROSTYRENE |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.172 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 347.0±27.0 °C at 760 mmHg |
| Melting Point | 168-170 °C(lit.) |
| Storage Condition | Store in airtight, cool and dry place |
| HTC | 2909500000 |
| PubChem ID | 126434 |
| SMILES | COc1cc(ccc1O)\C=C\[N+]([O-])=O |
| InChI | InChI=1S/C9H9NO4/c1-14-9-6-7(2-3-8(9)11)4-5-10(12)13/h2-6,11H,1H3/b5-4+ |
| InChI Key | InChIKey=XVXCSPJSXIUNQJ-SNAWJCMRSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(2-chlorophenyl)-1H-indol-5-amine | 1175822-65-7 | 2A-9071912 |
| 3-(4-methoxyphenyl)-1H-indol-5-amine | 770701-75-2 | 2A-9071913 |
| tert-butyl4-hydroxy-3-methoxyphenethylcarbamate | 23699-77-6 | 2A-9071919 |
| 2-(3-Chloropropyl)-2,5,5-trimethyl-1,3-dioxane | 88128-57-8 | 2A-9071920 |
| 2-methoxy-4-(2-nitroethyl)phenol | 528594-30-1 | 2A-9071921 |
| 4-Bromo-2-nitrobenzylbromide | 82420-34-6 | 2A-9071924 |
| Ethyl-2-t-butoxy-2-carboxylamino-3-nitrobenzoate | 136285-65-9 | 2A-9071925 |
| 4-Phenyl-1H-pyrazol-5-amine | 60523-82-2 | 2A-9071927 |
| 3-methoxy-3-oxopropanoicacid | 16695-14-0 | 2A-9071929 |
| 4-Phenyl-1H-pyrazol-5-amine | 57999-06-1 | 2A-9071930 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA